The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,1'-(butane-1,4-diyl)bis(3-(adamantan-1-yl)thiourea) ID: ALA4127510
PubChem CID: 145963401
Max Phase: Preclinical
Molecular Formula: C26H42N4S2
Molecular Weight: 474.78
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: S=C(NCCCCNC(=S)NC12CC3CC(CC(C3)C1)C2)NC12CC3CC(CC(C3)C1)C2
Standard InChI: InChI=1S/C26H42N4S2/c31-23(29-25-11-17-5-18(12-25)7-19(6-17)13-25)27-3-1-2-4-28-24(32)30-26-14-20-8-21(15-26)10-22(9-20)16-26/h17-22H,1-16H2,(H2,27,29,31)(H2,28,30,32)
Standard InChI Key: BRDDRYSQCPAUGP-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 37 0 0 0 0 0 0 0 0999 V2000
46.6980 -14.0435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7712 -14.1364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.5515 -14.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.9541 -15.3361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.8202 -15.3241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.0380 -14.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.3677 -14.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.5087 -14.0682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1436 -13.6532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.2994 -14.8503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6450 -14.2678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2802 -13.5865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4418 -14.0449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9848 -13.8466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1957 -14.3448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7297 -13.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4392 -13.2004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9905 -12.5405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2758 -12.7944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.7396 -12.8476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.4340 -14.0697 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.1418 -13.6613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8494 -14.0701 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.1420 -12.8441 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
39.5572 -13.6617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.2648 -14.0704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9726 -13.6620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.6802 -14.0708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3880 -13.6624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.0956 -14.0711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8034 -13.6627 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.0954 -14.8883 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
5 4 1 0
6 5 1 0
1 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
2 9 1 0
10 8 1 0
4 10 1 0
11 12 1 0
11 13 1 0
12 14 1 0
13 15 1 0
14 16 1 0
15 16 1 0
17 18 1 0
13 17 1 0
12 19 1 0
16 20 1 0
20 18 1 0
18 19 1 0
16 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
31 8 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.78Molecular Weight (Monoisotopic): 474.2851AlogP: 4.63#Rotatable Bonds: 7Polar Surface Area: 48.12Molecular Species: NEUTRALHBA: 2HBD: 4#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.87CX Basic pKa: ┄CX LogP: 4.54CX LogD: 4.54Aromatic Rings: ┄Heavy Atoms: 32QED Weighted: 0.32Np Likeness Score: -0.55
References 1. Burmistrov V, Morisseau C, Pitushkin D, Karlov D, Fayzullin RR, Butov GM, Hammock BD.. (2018) Adamantyl thioureas as soluble epoxide hydrolase inhibitors., 28 (13): [PMID:29803731 ] [10.1016/j.bmcl.2018.05.024 ]