The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-((1-(cyclopropanecarbonyl)piperidin-4-yl)methyl)-5-(4-(1-methyl-1H-indazol-5-yl)phenyl)-4,6-diazaspiro[2.4]hept-4-en-7-one ID: ALA4129083
PubChem CID: 89993363
Max Phase: Preclinical
Molecular Formula: C29H31N5O2
Molecular Weight: 481.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cn1ncc2cc(-c3ccc(C4=NC5(CC5)C(=O)N4CC4CCN(C(=O)C5CC5)CC4)cc3)ccc21
Standard InChI: InChI=1S/C29H31N5O2/c1-32-25-9-8-23(16-24(25)17-30-32)20-2-4-21(5-3-20)26-31-29(12-13-29)28(36)34(26)18-19-10-14-33(15-11-19)27(35)22-6-7-22/h2-5,8-9,16-17,19,22H,6-7,10-15,18H2,1H3
Standard InChI Key: UUOYALCZCRXMAS-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 42 0 0 0 0 0 0 0 0999 V2000
34.3839 -5.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8008 -4.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9791 -4.8615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7534 -5.1398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5730 -5.1410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7498 -3.7291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3425 -4.4383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5259 -4.4425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1158 -3.7303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2952 -3.7324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8838 -4.4460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3030 -5.1548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1222 -5.1492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0625 -4.4495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5767 -3.7892 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.8006 -4.0450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5825 -5.1155 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.8299 -3.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1343 -3.5621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.6290 -2.8358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1723 -3.4470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9683 -3.2787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2239 -2.5021 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.6772 -1.8935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8748 -2.0615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.0237 -2.3342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.5690 -2.9428 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.2781 -1.5576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.8828 -1.0135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.1062 -0.7590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5748 -3.7226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9831 -4.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7857 -4.2652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.8734 -3.4498 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.1250 -3.1145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3917 -4.8135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
1 3 1 0
4 5 2 0
5 32 1 0
31 6 1 0
6 7 2 0
7 4 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
7 8 1 0
11 14 1 0
14 15 1 0
15 16 1 0
16 2 1 0
2 17 1 0
17 14 2 0
15 18 1 0
16 19 2 0
18 20 1 0
20 21 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
23 26 1 0
26 27 2 0
26 28 1 0
29 28 1 0
30 29 1 0
28 30 1 0
31 32 2 0
32 33 1 0
33 34 1 0
34 35 2 0
35 31 1 0
33 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.60Molecular Weight (Monoisotopic): 481.2478AlogP: 4.01#Rotatable Bonds: 5Polar Surface Area: 70.80Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.43CX LogP: 3.26CX LogD: 3.26Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.55Np Likeness Score: -1.02
References 1. Lu T, Schubert C, Cummings MD, Bignan G, Connolly PJ, Smans K, Ludovici D, Parker MH, Meyer C, Rocaboy C, Alexander R, Grasberger B, De Breucker S, Esser N, Fraiponts E, Gilissen R, Janssens B, Peeters D, Van Nuffel L, Vermeulen P, Bischoff J, Meerpoel L.. (2018) Design and synthesis of a series of bioavailable fatty acid synthase (FASN) KR domain inhibitors for cancer therapy., 28 (12): [PMID:29779975 ] [10.1016/j.bmcl.2018.05.014 ]