(R)-3-((1-(cyclopropanecarbonyl)pyrrolidin-3-yl)methyl)-2-(4-(1-methyl-1H-indazol-5-yl)phenyl)-1,3-diazaspiro[4.4]non-1-en-4-one

ID: ALA4129240

PubChem CID: 117999149

Max Phase: Preclinical

Molecular Formula: C30H33N5O2

Molecular Weight: 495.63

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cn1ncc2cc(-c3ccc(C4=NC5(CCCC5)C(=O)N4C[C@@H]4CCN(C(=O)C5CC5)C4)cc3)ccc21

Standard InChI:  InChI=1S/C30H33N5O2/c1-33-26-11-10-24(16-25(26)17-31-33)21-4-6-22(7-5-21)27-32-30(13-2-3-14-30)29(37)35(27)19-20-12-15-34(18-20)28(36)23-8-9-23/h4-7,10-11,16-17,20,23H,2-3,8-9,12-15,18-19H2,1H3/t20-/m1/s1

Standard InChI Key:  CVEGCVNNECJUTJ-HXUWFJFHSA-N

Molfile:  

     RDKit          2D

 37 43  0  0  0  0  0  0  0  0999 V2000
   22.5266  -11.0133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8168  -10.6047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2088  -11.1536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5429  -11.9015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3574  -11.8147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4832  -11.2894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3027  -11.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4796   -9.8786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0722  -10.5878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2556  -10.5921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8455   -9.8799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0250   -9.8820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6135  -10.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0328  -11.3044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8520  -11.2988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3022   -9.8758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7129  -10.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5129  -10.4061    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.5941   -9.5915    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.8443   -9.2639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1269  -10.9541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7922  -10.5991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3065   -9.9387    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.5304  -10.1946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3122  -11.2650    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.5596   -9.1563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3623   -8.9827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9748   -9.5227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6806   -9.1109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5070   -8.3082    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.6898   -8.2266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0552   -7.6942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8594   -7.8604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7990   -6.9141    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4720   -8.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6382   -7.5999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8641   -9.7116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  7  2  0
  7 17  1  0
 16  8  1  0
  8  9  2  0
  9  6  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
  9 10  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 16  1  0
 18 21  1  0
 13 22  1  0
 22 23  1  0
 23 24  1  0
 24  1  1  0
  1 25  1  0
 25 22  2  0
 23 26  1  0
 27 26  1  1
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 27  1  0
 30 32  1  0
 32 33  1  0
 32 34  2  0
 35 33  1  0
 36 35  1  0
 33 36  1  0
 24 37  2  0
M  END

Associated Targets(Human)

FASN Tchem Fatty acid synthase (3390 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 495.63Molecular Weight (Monoisotopic): 495.2634AlogP: 4.40#Rotatable Bonds: 5
Polar Surface Area: 70.80Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.60CX LogP: 3.74CX LogD: 3.74
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.53Np Likeness Score: -1.01

References

1. Lu T, Schubert C, Cummings MD, Bignan G, Connolly PJ, Smans K, Ludovici D, Parker MH, Meyer C, Rocaboy C, Alexander R, Grasberger B, De Breucker S, Esser N, Fraiponts E, Gilissen R, Janssens B, Peeters D, Van Nuffel L, Vermeulen P, Bischoff J, Meerpoel L..  (2018)  Design and synthesis of a series of bioavailable fatty acid synthase (FASN) KR domain inhibitors for cancer therapy.,  28  (12): [PMID:29779975] [10.1016/j.bmcl.2018.05.014]

Source