5-(4-(benzofuran-5-yl)phenyl)-6-(((R)-1-((S)-tetrahydrofuran-2-carbonyl)pyrrolidin-3-yl)methyl)-4,6-diazaspiro[2.4]hept-4-en-7-one

ID: ALA4129242

PubChem CID: 145962440

Max Phase: Preclinical

Molecular Formula: C29H29N3O4

Molecular Weight: 483.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C([C@@H]1CCCO1)N1CC[C@@H](CN2C(=O)C3(CC3)N=C2c2ccc(-c3ccc4occc4c3)cc2)C1

Standard InChI:  InChI=1S/C29H29N3O4/c33-27(25-2-1-14-35-25)31-13-9-19(17-31)18-32-26(30-29(11-12-29)28(32)34)21-5-3-20(4-6-21)22-7-8-24-23(16-22)10-15-36-24/h3-8,10,15-16,19,25H,1-2,9,11-14,17-18H2/t19-,25+/m1/s1

Standard InChI Key:  MEWTUBNSHKJRBP-CLOONOSVSA-N

Molfile:  

     RDKit          2D

 36 42  0  0  0  0  0  0  0  0999 V2000
    1.4416   -5.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8624   -5.0788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0329   -5.0742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6229   -4.6513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2088   -3.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3805   -3.9345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9652   -4.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3884   -5.3704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2153   -5.3647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1361   -4.6584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6457   -3.9918    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8622   -4.2501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6514   -5.3306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9012   -3.2019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7115   -3.0267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3298   -3.5718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0423   -3.1561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8672   -2.3458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0422   -2.2634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4205   -1.7259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1619   -0.9384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1896   -3.7626    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4464   -4.6477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8576   -5.3601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6804   -5.3568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8490   -3.9342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6704   -3.9273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0919   -4.6362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8963   -4.4545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9720   -3.6332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2144   -3.3076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2252   -1.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5635   -2.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3836   -2.5548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5522   -1.7472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8363   -1.3375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  1  3  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
 12  2  1  0
  2 13  1  0
 13 10  2  0
 11 14  1  0
 15 14  1  1
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 15  1  0
 18 20  1  0
 20 21  2  0
 12 22  2  0
  4 23  1  0
 23 24  2  0
 24 25  1  0
 25 28  2  0
 27 26  2  0
 26 23  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 27  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 32  1  0
 32 20  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4129242

    ---

Associated Targets(Human)

FASN Tchem Fatty acid synthase (3390 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.57Molecular Weight (Monoisotopic): 483.2158AlogP: 4.25#Rotatable Bonds: 5
Polar Surface Area: 75.35Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.30CX LogP: 3.23CX LogD: 3.23
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.54Np Likeness Score: -0.44

References

1. Lu T, Schubert C, Cummings MD, Bignan G, Connolly PJ, Smans K, Ludovici D, Parker MH, Meyer C, Rocaboy C, Alexander R, Grasberger B, De Breucker S, Esser N, Fraiponts E, Gilissen R, Janssens B, Peeters D, Van Nuffel L, Vermeulen P, Bischoff J, Meerpoel L..  (2018)  Design and synthesis of a series of bioavailable fatty acid synthase (FASN) KR domain inhibitors for cancer therapy.,  28  (12): [PMID:29779975] [10.1016/j.bmcl.2018.05.014]

Source