2-Chloro-N-(4-(5-(3,4-dichlorophenyl)-3-(2,3-dihydroxypropoxy)-1H-1,2,4-triazol-1-yl)phenyl)acetamide

ID: ALA4129246

PubChem CID: 145962643

Max Phase: Preclinical

Molecular Formula: C19H17Cl3N4O4

Molecular Weight: 471.73

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CCl)Nc1ccc(-n2nc(OCC(O)CO)nc2-c2ccc(Cl)c(Cl)c2)cc1

Standard InChI:  InChI=1S/C19H17Cl3N4O4/c20-8-17(29)23-12-2-4-13(5-3-12)26-18(11-1-6-15(21)16(22)7-11)24-19(25-26)30-10-14(28)9-27/h1-7,14,27-28H,8-10H2,(H,23,29)

Standard InChI Key:  KJIQXYFYDZBWRZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    6.9667  -12.0969    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7839  -12.0969    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0383  -11.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3753  -10.8381    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.7166  -11.3202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9415  -11.0706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7723  -10.2700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9958  -10.0177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3878  -10.5651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5615  -11.3679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3378  -11.6165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4861  -12.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6725  -12.6665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1915  -13.3262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5229  -14.0741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3399  -14.1584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8173  -13.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8158  -11.0688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0425  -14.7352    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2298  -14.6499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7495  -15.3110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8974  -13.9033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9368  -15.2256    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.6102  -10.3139    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.9564  -11.9171    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    8.9868  -10.2697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7644  -10.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9354   -9.2191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7129   -8.9677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3709  -10.5659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  5  6  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  1 12  1  0
  3 18  1  0
 15 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
  9 24  1  0
 10 25  1  0
 18 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 27 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4129246

    ---

Associated Targets(Human)

Toledo (130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MALT1 Tchem Mucosa-associated lymphoid tissue lymphoma translocation protein 1 (705 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 471.73Molecular Weight (Monoisotopic): 470.0315AlogP: 3.15#Rotatable Bonds: 8
Polar Surface Area: 109.50Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.54CX Basic pKa: CX LogP: 3.58CX LogD: 3.58
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.44Np Likeness Score: -1.35

References

1. Wu G, Wang H, Zhou W, Zeng B, Mo W, Zhu K, Liu R, Zhou J, Chen C, Chen H..  (2018)  Synthesis and structure-activity relationship studies of MI-2 analogues as MALT1 inhibitors.,  26  (12): [PMID:29751989] [10.1016/j.bmc.2018.04.059]

Source