The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Chloro-N-(4-(5-(3,4-dichlorophenyl)-3-(2-(1-methyl-1H-indol-3-yl)ethoxy)-1H-1,2,4-triazol-1-yl)phenyl)acetamide ID: ALA4129327
PubChem CID: 145962228
Max Phase: Preclinical
Molecular Formula: C27H22Cl3N5O2
Molecular Weight: 554.87
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cc(CCOc2nc(-c3ccc(Cl)c(Cl)c3)n(-c3ccc(NC(=O)CCl)cc3)n2)c2ccccc21
Standard InChI: InChI=1S/C27H22Cl3N5O2/c1-34-16-18(21-4-2-3-5-24(21)34)12-13-37-27-32-26(17-6-11-22(29)23(30)14-17)35(33-27)20-9-7-19(8-10-20)31-25(36)15-28/h2-11,14,16H,12-13,15H2,1H3,(H,31,36)
Standard InChI Key: XYLQSXWSAOFUMZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
5.8483 -21.1438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6654 -21.1438 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9198 -20.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2568 -19.8850 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5981 -20.3671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8230 -20.1175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6538 -19.3169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8773 -19.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2693 -19.6120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4431 -20.4148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2193 -20.6634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3676 -21.8013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5540 -21.7134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0730 -22.3730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4044 -23.1210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2215 -23.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6989 -22.5447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6974 -20.1157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9241 -23.7821 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1113 -23.6967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6310 -24.3579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7789 -22.9502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8183 -24.2725 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.4917 -19.3608 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.8379 -20.9640 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.8684 -19.3166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6459 -19.0651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8169 -18.2660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6779 -16.9483 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2685 -17.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4771 -17.1193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5601 -17.9311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3034 -18.2634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9642 -17.7850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8769 -16.9705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1334 -16.6420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3465 -16.2013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
5 6 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
1 12 1 0
3 18 1 0
15 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
9 24 1 0
10 25 1 0
18 26 1 0
26 27 1 0
27 28 1 0
28 32 1 0
31 29 1 0
29 30 1 0
30 28 2 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
29 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 554.87Molecular Weight (Monoisotopic): 553.0839AlogP: 6.53#Rotatable Bonds: 8Polar Surface Area: 73.97Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.24CX LogD: 7.24Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.22Np Likeness Score: -1.50
References 1. Wu G, Wang H, Zhou W, Zeng B, Mo W, Zhu K, Liu R, Zhou J, Chen C, Chen H.. (2018) Synthesis and structure-activity relationship studies of MI-2 analogues as MALT1 inhibitors., 26 (12): [PMID:29751989 ] [10.1016/j.bmc.2018.04.059 ]