2-(4,5-di(1,3,2-dithiarsolan-2-yl)-6-hydroxy-3-oxo-3H-xanthen-9-yl)-3,4,5,6-tetrafluorobenzoic acid

ID: ALA4129708

PubChem CID: 57655011

Max Phase: Preclinical

Molecular Formula: C24H14As2F4O5S4

Molecular Weight: 736.48

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)c1c(F)c(F)c(F)c(F)c1-c1c2ccc(=O)c([As]3SCCS3)c-2oc2c([As]3SCCS3)c(O)ccc12

Standard InChI:  InChI=1S/C24H14As2F4O5S4/c27-18-14(15(24(33)34)19(28)21(30)20(18)29)13-9-1-3-11(31)16(25-36-5-6-37-25)22(9)35-23-10(13)2-4-12(32)17(23)26-38-7-8-39-26/h1-4,31H,5-8H2,(H,33,34)

Standard InChI Key:  BVPIXJAKHGMWHE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
   37.9774  -13.6566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9762  -14.4845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6921  -14.8997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4096  -14.4840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4066  -13.6530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6903  -13.2456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6902  -12.4235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6909  -10.7733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.4057  -11.1859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4058  -12.0099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1162  -12.4217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8309  -12.0098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8309  -11.1857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1161  -10.7735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9736  -12.0132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9774  -11.1877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2651  -10.7754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5525  -11.1834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5526  -12.0121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2615  -12.4247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5468  -10.7757    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.1149   -9.9480    0.0000 As  0  0  0  0  0  3  0  0  0  0  0  0
   37.2680   -9.9498    0.0000 As  0  0  0  0  0  3  0  0  0  0  0  0
   35.8377  -10.7714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.9411   -9.4664    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   37.6900   -8.6802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8645   -8.6772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6079   -9.4616    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   40.7821   -9.4662    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   40.5230   -8.6812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6973   -8.6824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4448   -9.4681    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   40.1206  -13.2395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8377  -13.6476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.8288  -12.8228    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.2665  -13.2452    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.2642  -14.8940    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.6919  -15.7210    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   40.1219  -14.8929    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7 10  2  0
  7 15  1  0
  9  8  1  0
  8 16  1  0
  6  7  1  0
  9 10  1  0
  9 14  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 21  2  0
 14 22  1  0
 17 23  1  0
 18 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 23  1  0
 22 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 22  1  0
  5 33  1  0
 33 34  1  0
 33 35  2  0
  1 36  1  0
  2 37  1  0
  3 38  1  0
  4 39  1  0
M  END

Associated Targets(Human)

PTPN7 Tchem Protein-tyrosine phosphatase LC-PTP (886 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 736.48Molecular Weight (Monoisotopic): 735.8092AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Korntner S, Pomorski A, Krężel A, Bishop AC..  (2018)  Optimized allosteric inhibition of engineered protein tyrosine phosphatases with an expanded palette of biarsenical small molecules.,  26  (9): [PMID:29673715] [10.1016/j.bmc.2018.04.026]

Source