The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-8-acetyl-3-((1-(cyclopropanecarbonyl)pyrrolidin-3-yl)methyl)-2-(4-(1-methyl-1H-indazol-5-yl)phenyl)-1,3,8-triazaspiro[4.5]dec-1-en-4-one ID: ALA4129812
PubChem CID: 117999184
Max Phase: Preclinical
Molecular Formula: C32H36N6O3
Molecular Weight: 552.68
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N1CCC2(CC1)N=C(c1ccc(-c3ccc4c(cnn4C)c3)cc1)N(C[C@@H]1CCN(C(=O)C3CC3)C1)C2=O
Standard InChI: InChI=1S/C32H36N6O3/c1-21(39)36-15-12-32(13-16-36)31(41)38(20-22-11-14-37(19-22)30(40)25-7-8-25)29(34-32)24-5-3-23(4-6-24)26-9-10-28-27(17-26)18-33-35(28)2/h3-6,9-10,17-18,22,25H,7-8,11-16,19-20H2,1-2H3/t22-/m1/s1
Standard InChI Key: PSMOEZPUOOVUGL-JOCHJYFZSA-N
Molfile:
RDKit 2D
41 47 0 0 0 0 0 0 0 0999 V2000
3.9869 -23.3973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2770 -22.9887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5721 -23.3969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5710 -24.2153 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2808 -24.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9919 -24.2141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9395 -23.6711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7591 -23.6722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9359 -22.2603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5286 -22.9695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7120 -22.9738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3019 -22.2616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4813 -22.2637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0699 -22.9772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4891 -23.6861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3083 -23.6805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7586 -22.2575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1692 -22.9650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9692 -22.7878 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0505 -21.9731 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3007 -21.6456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5833 -23.3358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2486 -22.9808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7629 -22.3204 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9868 -22.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7686 -23.6467 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0160 -21.5380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8186 -21.3644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4311 -21.9044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1370 -21.4926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9634 -20.6898 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1462 -20.6083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5115 -20.0759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3158 -20.2421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2554 -19.2958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.9284 -20.7859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0946 -19.9816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3204 -22.0933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8632 -24.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1555 -24.2153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8632 -25.4411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
7 8 2 0
8 18 1 0
17 9 1 0
9 10 2 0
10 7 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
10 11 1 0
17 18 2 0
18 19 1 0
19 20 1 0
20 21 2 0
21 17 1 0
19 22 1 0
14 23 1 0
23 24 1 0
24 25 1 0
25 1 1 0
1 26 1 0
26 23 2 0
24 27 1 0
28 27 1 1
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 28 1 0
31 33 1 0
33 34 1 0
33 35 2 0
36 34 1 0
37 36 1 0
34 37 1 0
25 38 2 0
4 39 1 0
39 40 2 0
39 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 552.68Molecular Weight (Monoisotopic): 552.2849AlogP: 3.47#Rotatable Bonds: 5Polar Surface Area: 91.11Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.47CX LogP: 1.64CX LogD: 1.64Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.48Np Likeness Score: -1.09
References 1. Lu T, Schubert C, Cummings MD, Bignan G, Connolly PJ, Smans K, Ludovici D, Parker MH, Meyer C, Rocaboy C, Alexander R, Grasberger B, De Breucker S, Esser N, Fraiponts E, Gilissen R, Janssens B, Peeters D, Van Nuffel L, Vermeulen P, Bischoff J, Meerpoel L.. (2018) Design and synthesis of a series of bioavailable fatty acid synthase (FASN) KR domain inhibitors for cancer therapy., 28 (12): [PMID:29779975 ] [10.1016/j.bmcl.2018.05.014 ]