(4-Bromo-2,3-dioxo-2,3-dihydro-indol-1-yl)-acetic acid (5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxy-phenyl)-5,5a,6,8,8a,9-hexahydro-furo[3',4':6,7]naphtho[2,3-d][1,3]dioxol-5-yl ester

ID: ALA4129912

PubChem CID: 145963705

Max Phase: Preclinical

Molecular Formula: C32H26BrNO11

Molecular Weight: 680.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc([C@@H]2c3cc4c(cc3[C@H](OC(=O)CN3C(=O)C(=O)c5c(Br)cccc53)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC

Standard InChI:  InChI=1S/C32H26BrNO11/c1-39-22-7-14(8-23(40-2)30(22)41-3)25-15-9-20-21(44-13-43-20)10-16(15)29(17-12-42-32(38)26(17)25)45-24(35)11-34-19-6-4-5-18(33)27(19)28(36)31(34)37/h4-10,17,25-26,29H,11-13H2,1-3H3/t17-,25+,26-,29-/m0/s1

Standard InChI Key:  FBAPRKXXBMBQMY-YNHBZXDASA-N

Molfile:  

     RDKit          2D

 47 53  0  0  0  0  0  0  0  0999 V2000
    6.5205  -27.2521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5205  -25.6095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8111  -26.8435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8137  -26.0240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1058  -25.6159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1048  -27.2532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3963  -26.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3906  -26.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6100  -25.7797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1358  -26.4461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6193  -27.1058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2300  -26.0222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2344  -26.8400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0138  -27.0913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4885  -26.4263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0065  -25.7666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2705  -27.8712    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5210  -28.0734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5191  -24.7881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2227  -25.2009    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.2302  -24.3742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2288  -23.5529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9428  -24.7857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6498  -24.3717    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3979  -24.7050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9478  -24.0926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7348  -23.5529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5360  -23.3844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7870  -22.6073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2380  -21.9979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4346  -22.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1873  -22.9520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5736  -25.5081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8071  -28.4806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8071  -29.3011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5197  -29.7143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2337  -29.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2301  -28.4776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5212  -30.5356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9472  -29.7067    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0953  -29.7139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3835  -29.3012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8102  -30.9455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9505  -30.5280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2268  -27.6607    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.5862  -22.4365    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   10.7607  -24.1763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  2  1  0
  3  1  1  0
  1 13  1  0
 12  2  1  0
  3  4  2  0
  4  5  1  0
  5  8  2  0
  7  6  2  0
  6  3  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 12  1  0
 14 17  2  0
  1 18  1  6
  2 19  1  6
 12 20  1  6
 19 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 28  1  0
 27 24  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 25 33  2  0
 18 34  2  0
 34 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 18  1  0
 36 39  1  0
 37 40  1  0
 35 41  1  0
 41 42  1  0
 39 43  1  0
 40 44  1  0
 13 45  1  1
 29 46  1  0
 26 47  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4129912

    ---

Associated Targets(Human)

K562/Adr (229 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 680.46Molecular Weight (Monoisotopic): 679.0689AlogP: 3.95#Rotatable Bonds: 7
Polar Surface Area: 136.13Molecular Species: NEUTRALHBA: 11HBD:
#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 3.35CX LogD: 3.35
Aromatic Rings: 3Heavy Atoms: 45QED Weighted: 0.27Np Likeness Score: 0.70

References

1. Wang J, Long L, Chen Y, Xu Y, Zhang L..  (2018)  Design, synthesis and antineoplastic activity of novel hybrids of podophyllotoxin and indirubin against human leukaemia cancer cells as multifunctional anti-MDR agents.,  28  (10): [PMID:29678463] [10.1016/j.bmcl.2018.04.019]
2. Zhang X, Rakesh KP, Shantharam CS, Manukumar HM, Asiri AM, Marwani HM, Qin HL..  (2018)  Podophyllotoxin derivatives as an excellent anticancer aspirant for future chemotherapy: A key current imminent needs.,  26  (2): [PMID:29269253] [10.1016/j.bmc.2017.11.026]
3. Kerru N, Singh P, Koorbanally N, Raj R, Kumar V..  (2017)  Recent advances (2015-2016) in anticancer hybrids.,  142  [PMID:28760313] [10.1016/j.ejmech.2017.07.033]

Source