The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Chloro-N-(4-(5-(3,4-dichlorophenyl)-3-(hexyloxy)-1H-1,2,4-triazol-1-yl)phenyl)acetamide ID: ALA4130220
PubChem CID: 145962058
Max Phase: Preclinical
Molecular Formula: C22H23Cl3N4O2
Molecular Weight: 481.81
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCOc1nc(-c2ccc(Cl)c(Cl)c2)n(-c2ccc(NC(=O)CCl)cc2)n1
Standard InChI: InChI=1S/C22H23Cl3N4O2/c1-2-3-4-5-12-31-22-27-21(15-6-11-18(24)19(25)13-15)29(28-22)17-9-7-16(8-10-17)26-20(30)14-23/h6-11,13H,2-5,12,14H2,1H3,(H,26,30)
Standard InChI Key: FMKMQFIKMYUGQM-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
16.5006 -10.5988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3178 -10.5988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5722 -9.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9092 -9.3399 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.2505 -9.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4754 -9.5725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3062 -8.7718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5297 -8.5196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9217 -9.0669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0954 -9.8697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8717 -10.1183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0200 -11.2562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2064 -11.1683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7254 -11.8280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0568 -12.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8738 -12.6602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3512 -11.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3497 -9.5706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5764 -13.2371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7637 -13.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2834 -13.8128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4313 -12.4051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4707 -13.7274 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
13.1441 -8.8158 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
13.4903 -10.4190 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.5207 -8.7715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2983 -8.5201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4693 -7.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2468 -7.4695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4179 -6.6704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1954 -6.4190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 1 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
5 6 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
1 12 1 0
3 18 1 0
15 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
9 24 1 0
10 25 1 0
18 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 481.81Molecular Weight (Monoisotopic): 480.0887AlogP: 6.38#Rotatable Bonds: 10Polar Surface Area: 69.04Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 7.11CX LogD: 7.11Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.27Np Likeness Score: -1.52
References 1. Wu G, Wang H, Zhou W, Zeng B, Mo W, Zhu K, Liu R, Zhou J, Chen C, Chen H.. (2018) Synthesis and structure-activity relationship studies of MI-2 analogues as MALT1 inhibitors., 26 (12): [PMID:29751989 ] [10.1016/j.bmc.2018.04.059 ]