The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,1'-(octane-1,8-diyl)bis(3-(adamantan-1-yl)thiourea) ID: ALA4130236
PubChem CID: 145962686
Max Phase: Preclinical
Molecular Formula: C30H50N4S2
Molecular Weight: 530.89
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: S=C(NCCCCCCCCNC(=S)NC12CC3CC(CC(C3)C1)C2)NC12CC3CC(CC(C3)C1)C2
Standard InChI: InChI=1S/C30H50N4S2/c35-27(33-29-15-21-9-22(16-29)11-23(10-21)17-29)31-7-5-3-1-2-4-6-8-32-28(36)34-30-18-24-12-25(19-30)14-26(13-24)20-30/h21-26H,1-20H2,(H2,31,33,35)(H2,32,34,36)
Standard InChI Key: ZKQUPMKECRYQAG-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
15.5105 -22.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5837 -22.7168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3639 -23.4350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7666 -23.9165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6327 -23.9045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8505 -23.1230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1802 -22.6095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3211 -22.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9561 -22.2336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1119 -23.4307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6243 -22.8441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2594 -22.1629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4211 -22.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9641 -22.4230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1749 -22.9211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7089 -22.2393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4184 -21.7768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9697 -21.1169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2550 -21.3708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7189 -21.4240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4132 -22.6461 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1210 -22.2377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8286 -22.6465 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1212 -21.4205 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.5364 -22.2380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2441 -22.6468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9519 -22.2384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6595 -22.6472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3673 -22.2387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0749 -22.6475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7827 -22.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4903 -22.6479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1981 -22.2394 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9057 -22.6482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6135 -22.2398 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9055 -23.4654 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
5 4 1 0
6 5 1 0
1 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
2 9 1 0
10 8 1 0
4 10 1 0
11 12 1 0
11 13 1 0
12 14 1 0
13 15 1 0
14 16 1 0
15 16 1 0
17 18 1 0
13 17 1 0
12 19 1 0
16 20 1 0
20 18 1 0
18 19 1 0
16 21 1 0
21 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
35 8 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 530.89Molecular Weight (Monoisotopic): 530.3477AlogP: 6.19#Rotatable Bonds: 11Polar Surface Area: 48.12Molecular Species: NEUTRALHBA: 2HBD: 4#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.87CX Basic pKa: ┄CX LogP: 6.31CX LogD: 6.31Aromatic Rings: ┄Heavy Atoms: 36QED Weighted: 0.19Np Likeness Score: -0.46
References 1. Burmistrov V, Morisseau C, Pitushkin D, Karlov D, Fayzullin RR, Butov GM, Hammock BD.. (2018) Adamantyl thioureas as soluble epoxide hydrolase inhibitors., 28 (13): [PMID:29803731 ] [10.1016/j.bmcl.2018.05.024 ]