The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-6-amino-2-((S)-2-((S)-2-((S)-2-azido-3-phenylpropanamido)-4-methylpentanamido)-4-methylpentanamido)hexane-1-sulfonylfluoride ID: ALA4130258
PubChem CID: 145963518
Max Phase: Preclinical
Molecular Formula: C27H44FN7O5S
Molecular Weight: 597.76
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)N=[N+]=[N-])C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)CS(=O)(=O)F
Standard InChI: InChI=1S/C27H44FN7O5S/c1-18(2)14-22(25(36)31-21(12-8-9-13-29)17-41(28,39)40)32-26(37)23(15-19(3)4)33-27(38)24(34-35-30)16-20-10-6-5-7-11-20/h5-7,10-11,18-19,21-24H,8-9,12-17,29H2,1-4H3,(H,31,36)(H,32,37)(H,33,38)/t21-,22-,23-,24-/m0/s1
Standard InChI Key: MGAGNLOPCIZNFW-ZJZGAYNASA-N
Molfile:
RDKit 2D
41 41 0 0 0 0 0 0 0 0999 V2000
39.1960 -21.8085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.3710 -21.8085 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
38.7835 -22.5229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.5127 -22.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2272 -21.8126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7982 -21.8126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.2272 -20.9877 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.9416 -22.2251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.6561 -21.8126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3706 -22.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6561 -20.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3706 -20.5752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3706 -19.7502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0850 -20.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3706 -23.0501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.0850 -21.8126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.7995 -22.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5141 -21.8126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7995 -23.0501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5141 -23.4626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.5141 -24.2876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2285 -23.0501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.2285 -22.2251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.5141 -20.9877 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.9430 -21.8126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6575 -22.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9430 -20.9876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3669 -20.9834 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.6575 -20.5752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5127 -23.0501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6575 -19.7502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3719 -19.3377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.3719 -18.5126 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.2272 -23.4626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2224 -24.2887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9361 -24.7012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6516 -24.2885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6488 -23.4593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9347 -23.0506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0838 -22.2251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.3693 -22.6376 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 6 1 0
5 7 2 0
5 8 1 0
8 9 1 0
9 10 1 0
9 11 1 1
11 12 1 0
12 13 1 0
12 14 1 0
10 15 2 0
10 16 1 0
16 17 1 0
17 18 1 0
17 19 1 6
19 20 1 0
20 21 1 0
20 22 1 0
18 23 1 0
18 24 2 0
23 25 1 0
25 26 1 0
25 27 1 1
26 2 1 0
2 28 1 0
27 29 1 0
4 30 1 6
29 31 1 0
31 32 1 0
32 33 1 0
30 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
6 40 2 0
40 41 2 0
M CHG 2 40 1 41 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 597.76Molecular Weight (Monoisotopic): 597.3109AlogP: 2.88#Rotatable Bonds: 19Polar Surface Area: 196.22Molecular Species: ZWITTERIONHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: -10.27CX Basic pKa: 9.80CX LogP: 2.64CX LogD: 0.21Aromatic Rings: 1Heavy Atoms: 41QED Weighted: 0.06Np Likeness Score: 0.16
References 1. Artschwager R, Ward DJ, Gannon S, Brouwer AJ, van de Langemheen H, Kowalski H, Liskamp RMJ.. (2018) Potent and Highly Selective Inhibitors of the Proteasome Trypsin-like Site by Incorporation of Basic Side Chain Containing Amino Acid Derived Sulfonyl Fluorides., 61 (12): [PMID:29782167 ] [10.1021/acs.jmedchem.8b00685 ]