(S)-6-amino-2-((S)-2-((S)-2-((S)-2-azido-3-phenylpropanamido)-4-methylpentanamido)-4-methylpentanamido)hexane-1-sulfonylfluoride

ID: ALA4130258

PubChem CID: 145963518

Max Phase: Preclinical

Molecular Formula: C27H44FN7O5S

Molecular Weight: 597.76

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)N=[N+]=[N-])C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)CS(=O)(=O)F

Standard InChI:  InChI=1S/C27H44FN7O5S/c1-18(2)14-22(25(36)31-21(12-8-9-13-29)17-41(28,39)40)32-26(37)23(15-19(3)4)33-27(38)24(34-35-30)16-20-10-6-5-7-11-20/h5-7,10-11,18-19,21-24H,8-9,12-17,29H2,1-4H3,(H,31,36)(H,32,37)(H,33,38)/t21-,22-,23-,24-/m0/s1

Standard InChI Key:  MGAGNLOPCIZNFW-ZJZGAYNASA-N

Molfile:  

     RDKit          2D

 41 41  0  0  0  0  0  0  0  0999 V2000
   39.1960  -21.8085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.3710  -21.8085    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   38.7835  -22.5229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.5127  -22.2251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2272  -21.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7982  -21.8126    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.2272  -20.9877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.9416  -22.2251    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.6561  -21.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3706  -22.2251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6561  -20.9877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3706  -20.5752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3706  -19.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.0850  -20.9877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.3706  -23.0501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.0850  -21.8126    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.7995  -22.2251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5141  -21.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.7995  -23.0501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5141  -23.4626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5141  -24.2876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2285  -23.0501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2285  -22.2251    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.5141  -20.9877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.9430  -21.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6575  -22.2251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9430  -20.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3669  -20.9834    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.6575  -20.5752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.5127  -23.0501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6575  -19.7502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3719  -19.3377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3719  -18.5126    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.2272  -23.4626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2224  -24.2887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9361  -24.7012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6516  -24.2885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6488  -23.4593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9347  -23.0506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0838  -22.2251    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.3693  -22.6376    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  4  6  1  0
  5  7  2  0
  5  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  1
 11 12  1  0
 12 13  1  0
 12 14  1  0
 10 15  2  0
 10 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  1  6
 19 20  1  0
 20 21  1  0
 20 22  1  0
 18 23  1  0
 18 24  2  0
 23 25  1  0
 25 26  1  0
 25 27  1  1
 26  2  1  0
  2 28  1  0
 27 29  1  0
  4 30  1  6
 29 31  1  0
 31 32  1  0
 32 33  1  0
 30 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
  6 40  2  0
 40 41  2  0
M  CHG  2  40   1  41  -1
M  END

Alternative Forms

  1. Parent:

    ALA4130258

    ---

Associated Targets(Human)

PSMB2 Tclin Proteasome Macropain subunit (1025 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PSMB5 Tclin Proteasome Macropain subunit MB1 (2451 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 597.76Molecular Weight (Monoisotopic): 597.3109AlogP: 2.88#Rotatable Bonds: 19
Polar Surface Area: 196.22Molecular Species: ZWITTERIONHBA: 7HBD: 4
#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: -10.27CX Basic pKa: 9.80CX LogP: 2.64CX LogD: 0.21
Aromatic Rings: 1Heavy Atoms: 41QED Weighted: 0.06Np Likeness Score: 0.16

References

1. Artschwager R, Ward DJ, Gannon S, Brouwer AJ, van de Langemheen H, Kowalski H, Liskamp RMJ..  (2018)  Potent and Highly Selective Inhibitors of the Proteasome Trypsin-like Site by Incorporation of Basic Side Chain Containing Amino Acid Derived Sulfonyl Fluorides.,  61  (12): [PMID:29782167] [10.1021/acs.jmedchem.8b00685]

Source