2-Chloro-N-(4-(5-(3,4-dichlorophenyl)-3-(4-phenylbutoxy)-1H-1,2,4-triazol-1-yl)phenyl)acetamide

ID: ALA4130298

PubChem CID: 145955649

Max Phase: Preclinical

Molecular Formula: C26H23Cl3N4O2

Molecular Weight: 529.86

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CCl)Nc1ccc(-n2nc(OCCCCc3ccccc3)nc2-c2ccc(Cl)c(Cl)c2)cc1

Standard InChI:  InChI=1S/C26H23Cl3N4O2/c27-17-24(34)30-20-10-12-21(13-11-20)33-25(19-9-14-22(28)23(29)16-19)31-26(32-33)35-15-5-4-8-18-6-2-1-3-7-18/h1-3,6-7,9-14,16H,4-5,8,15,17H2,(H,30,34)

Standard InChI Key:  NEUFWEWCAAMACR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   25.2297  -23.5665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.0469  -23.5665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.3013  -22.7898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6383  -22.3077    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.9796  -22.7898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2045  -22.5402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0353  -21.7396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2588  -21.4873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6508  -22.0347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8245  -22.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6008  -23.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7491  -24.2240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9355  -24.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4545  -24.7957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7858  -25.5437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6029  -25.6280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0803  -24.9673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0788  -22.5384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3055  -26.2048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.4928  -26.1194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0125  -26.7806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1604  -25.3729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.1998  -26.6952    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   21.8732  -21.7835    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   22.2194  -23.3867    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   27.2498  -21.7393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.0274  -21.4878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1948  -20.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9714  -20.4370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1394  -19.6372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9145  -19.3876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0827  -18.5887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4738  -18.0423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6940  -18.3005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5294  -19.0988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  5  6  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  1 12  1  0
  3 18  1  0
 15 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
  9 24  1  0
 10 25  1  0
 18 26  1  0
 26 27  1  0
 28 27  1  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4130298

    ---

Associated Targets(Human)

Toledo (130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 529.86Molecular Weight (Monoisotopic): 528.0887AlogP: 6.82#Rotatable Bonds: 10
Polar Surface Area: 69.04Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 7.80CX LogD: 7.80
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.18Np Likeness Score: -1.43

References

1. Wu G, Wang H, Zhou W, Zeng B, Mo W, Zhu K, Liu R, Zhou J, Chen C, Chen H..  (2018)  Synthesis and structure-activity relationship studies of MI-2 analogues as MALT1 inhibitors.,  26  (12): [PMID:29751989] [10.1016/j.bmc.2018.04.059]

Source