(cis)-9-(3-bromo-4-fluorophenyl)-5-methyl-5,9-dihydro-3Hfuro[3,4-b]pyrano[4,3-e]pyridine-1,8(4H,7H)-dione

ID: ALA413532

PubChem CID: 44417593

Max Phase: Preclinical

Molecular Formula: C17H13BrFNO4

Molecular Weight: 394.20

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@H]1OCC(=O)C2=C1N=C1COC(O)=C1[C@@H]2c1ccc(F)c(Br)c1

Standard InChI:  InChI=1S/C17H13BrFNO4/c1-7-16-15(12(21)6-23-7)13(8-2-3-10(19)9(18)4-8)14-11(20-16)5-24-17(14)22/h2-4,7,13,22H,5-6H2,1H3/t7-,13+/m1/s1

Standard InChI Key:  OCJYJJSGANKJAI-UHLUBPPHSA-N

Molfile:  

     RDKit          2D

 24 27  0  0  1  0  0  0  0  0999 V2000
    1.0042  -14.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0042  -15.3917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7162  -15.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7162  -14.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4282  -14.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4266  -15.3898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1375  -15.8010    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1367  -14.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8482  -14.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8489  -15.3941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6387  -15.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1262  -14.9779    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6376  -14.3067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1341  -13.3349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8492  -12.9213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8476  -12.0971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1316  -11.6855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4157  -12.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4209  -12.9270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7162  -13.3250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8919  -13.5219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1285  -10.8605    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.5613  -11.6832    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    1.7174  -16.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  5  6  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13  9  2  0
  1  4  1  0
  6  7  1  0
 14 15  2  0
  7 10  2  0
 15 16  1  0
  2  3  1  0
 16 17  2  0
  9  8  1  0
 17 18  1  0
  8  5  1  0
 18 19  2  0
 19 14  1  0
  8 14  1  1
  9 10  1  0
  4 20  2  0
  3  6  1  0
 13 21  1  0
  5  4  1  0
 17 22  1  0
 16 23  1  0
  1  2  1  0
  3 24  1  1
M  END

Associated Targets(Human)

KCNJ11 Tclin Sulfonylurea receptor 2, Kir6.2 (426 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 394.20Molecular Weight (Monoisotopic): 393.0012AlogP: 3.17#Rotatable Bonds: 1
Polar Surface Area: 68.12Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 4.95CX Basic pKa: 1.49CX LogP: 2.86CX LogD: 0.44
Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.79Np Likeness Score: -0.06

References

1. Altenbach RJ, Brune ME, Buckner SA, Coghlan MJ, Daza AV, Fabiyi A, Gopalakrishnan M, Henry RF, Khilevich A, Kort ME, Milicic I, Scott VE, Smith JC, Whiteaker KL, Carroll WA..  (2006)  Effects of substitution on 9-(3-bromo-4-fluorophenyl)-5,9-dihydro-3H,4H-2,6-dioxa-4- azacyclopenta[b]naphthalene-1,8-dione, a dihydropyridine ATP-sensitive potassium channel opener.,  49  (23): [PMID:17154517] [10.1021/jm060549u]

Source