The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-[5-(furan-2-yl)uracil-1-yl]-2-(2,3-di-O-benzyl-2-butene-4-olidylidene)ethane ID: ALA415062
PubChem CID: 44422814
Max Phase: Preclinical
Molecular Formula: C28H22N2O7
Molecular Weight: 498.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1O/C(=C\Cn2cc(-c3ccco3)c(=O)[nH]c2=O)C(OCc2ccccc2)=C1OCc1ccccc1
Standard InChI: InChI=1S/C28H22N2O7/c31-26-21(22-12-7-15-34-22)16-30(28(33)29-26)14-13-23-24(35-17-19-8-3-1-4-9-19)25(27(32)37-23)36-18-20-10-5-2-6-11-20/h1-13,15-16H,14,17-18H2,(H,29,31,33)/b23-13-
Standard InChI Key: NXNXBWRMKOBSFM-QRVIBDJDSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
-3.2514 0.5519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5349 0.1537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8294 0.5710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8401 1.3979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5584 1.8038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5695 2.6310 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5238 -0.6735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8062 -1.0723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0943 -0.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3338 -0.9747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2085 -0.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2135 0.3556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0170 0.1733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1169 1.1096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0306 -0.4339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4148 -1.1620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2392 -1.1957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6209 -1.9254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4482 -1.9515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8853 -1.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4984 -0.5157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6732 -0.4947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2920 -1.8012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9818 -2.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9379 -3.0742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6279 -3.5247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5863 -4.3451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8502 -4.7185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1566 -4.2657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2005 -3.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9636 0.1285 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1324 1.8170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3751 1.4857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1685 2.1030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2507 2.8108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0533 2.6308 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2643 1.3768 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4 5 1 0
5 6 2 0
2 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 9 1 0
12 14 2 0
11 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
10 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
1 31 2 0
4 32 1 0
32 33 2 0
1 2 1 0
2 3 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 32 1 0
3 4 2 0
37 1 1 0
37 5 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.49Molecular Weight (Monoisotopic): 498.1427AlogP: 3.88#Rotatable Bonds: 9Polar Surface Area: 112.76Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.55CX Basic pKa: ┄CX LogP: 2.96CX LogD: 2.96Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.35Np Likeness Score: -0.23
References 1. Gazivoda T, Raić-Malić S, Marjanović M, Kralj M, Pavelić K, Balzarini J, De Clercq E, Mintas M.. (2007) The novel C-5 aryl, alkenyl, and alkynyl substituted uracil derivatives of L-ascorbic acid: synthesis, cytostatic, and antiviral activity evaluations., 15 (2): [PMID:17092728 ] [10.1016/j.bmc.2006.10.046 ]