The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-amino-5-(diaminomethyleneamino)-N,N-dinonylpentanamide hydrochloride ID: ALA4159340
PubChem CID: 145958359
Max Phase: Preclinical
Molecular Formula: C24H54Cl3N5O
Molecular Weight: 425.71
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCN(CCCCCCCCC)C(=O)[C@@H](N)CCCN=C(N)N.Cl.Cl.Cl
Standard InChI: InChI=1S/C24H51N5O.3ClH/c1-3-5-7-9-11-13-15-20-29(21-16-14-12-10-8-6-4-2)23(30)22(25)18-17-19-28-24(26)27;;;/h22H,3-21,25H2,1-2H3,(H4,26,27,28);3*1H/t22-;;;/m0.../s1
Standard InChI Key: MOQBDAKBAYTQAP-NNUMAELLSA-N
Molfile:
RDKit 2D
33 29 0 0 0 0 0 0 0 0999 V2000
1.8857 -15.4982 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.9935 -14.2896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7072 -13.8758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4209 -14.2896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1347 -13.8758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8443 -14.2896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1347 -13.0523 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2797 -13.8758 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8443 -15.1131 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5581 -13.8758 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2719 -14.2896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5581 -13.0523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2719 -12.6426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9856 -13.8758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2719 -11.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9856 -11.4052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6993 -14.2896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4131 -13.8758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9856 -10.5817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1268 -14.2896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6993 -10.1720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8364 -13.8758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6993 -9.3485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5501 -14.2896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4131 -8.9347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2640 -13.8758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5660 -14.2896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8523 -13.8758 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5660 -15.1131 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.1268 -9.3485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2640 -13.0523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3330 -12.9348 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.9134 -14.0545 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
5 7 1 6
2 8 1 0
6 9 2 0
6 10 1 0
10 11 1 0
10 12 1 0
12 13 1 0
11 14 1 0
13 15 1 0
15 16 1 0
14 17 1 0
17 18 1 0
16 19 1 0
18 20 1 0
19 21 1 0
20 22 1 0
21 23 1 0
22 24 1 0
23 25 1 0
24 26 1 0
8 27 2 0
27 28 1 0
27 29 1 0
25 30 1 0
26 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.71Molecular Weight (Monoisotopic): 425.4094AlogP: 4.70#Rotatable Bonds: 21Polar Surface Area: 110.73Molecular Species: BASEHBA: 3HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 11.31CX LogP: 5.19CX LogD: 2.05Aromatic Rings: ┄Heavy Atoms: 30QED Weighted: 0.14Np Likeness Score: 0.35
References 1. Zhang E, Bai PY, Cui DY, Chu WC, Hua YG, Liu Q, Yin HY, Zhang YJ, Qin S, Liu HM.. (2018) Synthesis and bioactivities study of new antibacterial peptide mimics: The dialkyl cationic amphiphiles., 143 [PMID:29126736 ] [10.1016/j.ejmech.2017.10.044 ]