2-(3-(benzo[d][1,3]dioxol-5-yl)-8-methyl-2-oxo-2Hchromen-6-yl)-3-methyl-2,3-dihydroquinazolin-4(1H)-one

ID: ALA4159670

PubChem CID: 145957123

Max Phase: Preclinical

Molecular Formula: C26H20N2O5

Molecular Weight: 440.46

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(C2Nc3ccccc3C(=O)N2C)cc2cc(-c3ccc4c(c3)OCO4)c(=O)oc12

Standard InChI:  InChI=1S/C26H20N2O5/c1-14-9-17(24-27-20-6-4-3-5-18(20)25(29)28(24)2)10-16-11-19(26(30)33-23(14)16)15-7-8-21-22(12-15)32-13-31-21/h3-12,24,27H,13H2,1-2H3

Standard InChI Key:  CAZWRMSKNVPDGX-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
    5.3227  -20.2440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3216  -21.0636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0296  -21.4725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0278  -19.8352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7364  -20.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7353  -21.0611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4415  -21.4701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1534  -21.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1545  -20.2424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4438  -19.8288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8598  -21.4698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8561  -22.2881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5619  -22.6986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5650  -21.0637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8632  -19.8355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6171  -21.4693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9098  -21.0580    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2039  -21.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6184  -22.2852    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9063  -22.6914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2033  -22.2790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4967  -22.6816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4920  -23.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1997  -23.9070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9034  -23.5020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9124  -20.2408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4970  -21.0525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0254  -19.0180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2714  -21.4705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2725  -22.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0507  -22.5401    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.5306  -21.8777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0489  -21.2167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 11 12  2  0
 12 13  1  0
 13 30  2  0
 29 14  2  0
 14 11  1  0
  8 11  1  0
  9 15  2  0
 16 17  1  0
 16 19  1  0
 17 18  1  0
 18 21  1  0
 20 19  1  0
  2 16  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 17 26  1  0
 18 27  2  0
  4 28  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4159670

    ---

Associated Targets(Human)

HCAR2 Tclin Hydroxycarboxylic acid receptor 2 (1903 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 440.46Molecular Weight (Monoisotopic): 440.1372AlogP: 4.69#Rotatable Bonds: 2
Polar Surface Area: 81.01Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.47CX Basic pKa: CX LogP: 4.89CX LogD: 4.89
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.46Np Likeness Score: -0.25

References

1. Singh LR, Kumar A, Upadhyay A, Gupta S, Palanati GR, Sikka K, Siddiqi MI, Yadav PN, Sashidhara KV..  (2018)  Discovery of coumarin-dihydroquinazolinone analogs as niacin receptor 1 agonist with in-vivo anti-obesity efficacy.,  152  [PMID:29709786] [10.1016/j.ejmech.2018.04.037]

Source