2-{[2-(1,1-Dioxido-2,3-dihydro-1,4-benzothiazepin-4(5H)-yl)-6-methylquinolin-4-yl]amino}ethanol

ID: ALA4160231

PubChem CID: 145956387

Max Phase: Preclinical

Molecular Formula: C22H24FN3O

Molecular Weight: 365.45

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc2nc(N3CCCc4ccc(F)cc4C3)cc(NCCO)c2c1

Standard InChI:  InChI=1S/C22H24FN3O/c1-15-4-7-20-19(11-15)21(24-8-10-27)13-22(25-20)26-9-2-3-16-5-6-18(23)12-17(16)14-26/h4-7,11-13,27H,2-3,8-10,14H2,1H3,(H,24,25)

Standard InChI Key:  GVLXAEVMZNYKHZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   15.1879   -4.6664    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8976   -4.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8948   -3.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1861   -3.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4799   -4.2575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4822   -3.4397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7762   -3.0307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0675   -3.4382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0692   -4.2591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7757   -4.6645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6059   -4.6645    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1826   -2.2119    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8886   -1.8003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5980   -2.2058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3040   -1.7942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2738   -4.2044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5429   -5.4798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1452   -6.0343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9534   -5.9070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0546   -4.4418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3612   -5.2002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1695   -5.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6721   -4.6675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3607   -3.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5532   -3.7990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3598   -3.0297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8603   -3.2611    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  5  1  1  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  5  2  0
  2 11  1  0
  4 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 11 16  1  0
 16 20  1  0
 11 17  1  0
 17 18  1  0
 21 19  1  0
 18 19  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
  8 26  1  0
 24 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4160231

    ---

Associated Targets(Human)

HEp-2 (3859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

F Fusion glycoprotein F0 (242 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 365.45Molecular Weight (Monoisotopic): 365.1903AlogP: 4.04#Rotatable Bonds: 4
Polar Surface Area: 48.39Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.28CX LogP: 4.48CX LogD: 2.92
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.73Np Likeness Score: -1.54

References

1. Zheng X, Liang C, Wang L, Wang B, Liu Y, Feng S, Wu JZ, Gao L, Feng L, Chen L, Guo T, Shen HC, Yun H..  (2018)  Discovery of Benzoazepinequinoline (BAQ) Derivatives as Novel, Potent, Orally Bioavailable Respiratory Syncytial Virus Fusion Inhibitors.,  61  (22): [PMID:30339388] [10.1021/acs.jmedchem.8b01394]

Source