The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2,2'-bithiophen-5-yl)-N-(3-fluorophenethyl)-5-(trifluoromethyl)benzenesulfonamide ID: ALA4161318
PubChem CID: 145959430
Max Phase: Preclinical
Molecular Formula: C23H17F4NO2S3
Molecular Weight: 511.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(NCCc1cccc(F)c1)c1cc(-c2ccc(-c3cccs3)s2)cc(C(F)(F)F)c1
Standard InChI: InChI=1S/C23H17F4NO2S3/c24-18-4-1-3-15(11-18)8-9-28-33(29,30)19-13-16(12-17(14-19)23(25,26)27)20-6-7-22(32-20)21-5-2-10-31-21/h1-7,10-14,28H,8-9H2
Standard InChI Key: RBKQHDPHYQYDQR-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
28.3662 -25.1241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.1912 -25.1282 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
28.7803 -24.4111 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.4851 -26.3720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4838 -27.1994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1993 -27.6102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9163 -27.1990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9135 -26.3684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1975 -25.9572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7685 -27.6093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0538 -27.1983 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.7678 -28.4343 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.0478 -28.0179 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.9089 -24.7196 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.6210 -25.1278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3348 -24.7153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0511 -25.1236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0516 -25.9461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7670 -26.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4819 -25.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4767 -25.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7607 -24.7079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7690 -27.1835 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.6243 -27.6075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7182 -28.4211 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.5220 -28.5909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9307 -27.8786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3793 -27.2714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8580 -29.3419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4436 -30.0571 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
31.9972 -30.6712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7513 -30.3330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6651 -29.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
5 10 1 0
10 11 1 0
10 12 1 0
10 13 1 0
9 2 1 0
2 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
19 23 1 0
7 24 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 24 2 0
29 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 29 2 0
26 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 511.59Molecular Weight (Monoisotopic): 511.0358AlogP: 6.82#Rotatable Bonds: 7Polar Surface Area: 46.17Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.85CX Basic pKa: ┄CX LogP: 6.68CX LogD: 6.68Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.28Np Likeness Score: -1.73
References 1. Giordano A, Forte G, Massimo L, Riccio R, Bifulco G, Di Micco S.. (2018) Discovery of new erbB4 inhibitors: Repositioning an orphan chemical library by inverse virtual screening., 152 [PMID:29730188 ] [10.1016/j.ejmech.2018.04.018 ]