4-((4-(8-Oxo-7,8,9,10,11,12-hexahydrobenzo[c]acridin-7-yl)phenoxy)methyl)benzoic acid

ID: ALA4162185

PubChem CID: 145956501

Max Phase: Preclinical

Molecular Formula: C31H25NO4

Molecular Weight: 475.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C1CCCC2=C1C(c1ccc(OCc3ccc(C(=O)O)cc3)cc1)c1ccc3ccccc3c1N2

Standard InChI:  InChI=1S/C31H25NO4/c33-27-7-3-6-26-29(27)28(25-17-14-20-4-1-2-5-24(20)30(25)32-26)21-12-15-23(16-13-21)36-18-19-8-10-22(11-9-19)31(34)35/h1-2,4-5,8-17,28,32H,3,6-7,18H2,(H,34,35)

Standard InChI Key:  OEWSFPVLNFZYKA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
    2.0085  -17.4953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0074  -18.3148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7154  -18.7238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4251  -18.3143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4223  -17.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7137  -17.0864    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2994  -18.7229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5920  -18.3137    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2987  -19.5400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1284  -17.0804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8377  -17.4864    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5438  -17.0751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2515  -17.4844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9572  -17.0738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9546  -16.2558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2403  -15.8500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5376  -16.2629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6602  -15.8436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0702  -15.0227    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6509  -15.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3612  -14.6190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3639  -13.8049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6580  -13.3916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9477  -13.7985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9433  -14.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2348  -15.0261    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0681  -15.8368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3663  -16.2482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3727  -17.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0802  -17.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7728  -16.2344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7790  -17.0437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4819  -17.4412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1790  -17.0305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1689  -16.2182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4655  -15.8243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  2  0
  7  9  1  0
  5 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15 18  1  0
 18 28  1  0
 18 20  1  0
 27 19  1  0
 19 21  1  0
 20 21  2  0
 20 25  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 32  1  0
 31 27  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 31  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4162185

    ---

Associated Targets(non-human)

GCN5 Histone acetyltransferase GCN5 (89 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 475.54Molecular Weight (Monoisotopic): 475.1784AlogP: 6.68#Rotatable Bonds: 5
Polar Surface Area: 75.63Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.06CX Basic pKa: CX LogP: 5.73CX LogD: 2.61
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.34Np Likeness Score: -0.45

References

1. Xiong H, Han J, Wang J, Lu W, Wang C, Chen Y, Fulin Lian, Zhang N, Liu YC, Zhang C, Ding H, Jiang H, Lu W, Luo C, Zhou B..  (2018)  Discovery of 1,8-acridinedione derivatives as novel GCN5 inhibitors via high throughput screening.,  151  [PMID:29665527] [10.1016/j.ejmech.2018.02.005]

Source