The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-((4-(8-Oxo-7,8,9,10,11,12-hexahydrobenzo[c]acridin-7-yl)phenoxy)methyl)benzoic acid ID: ALA4162185
PubChem CID: 145956501
Max Phase: Preclinical
Molecular Formula: C31H25NO4
Molecular Weight: 475.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1CCCC2=C1C(c1ccc(OCc3ccc(C(=O)O)cc3)cc1)c1ccc3ccccc3c1N2
Standard InChI: InChI=1S/C31H25NO4/c33-27-7-3-6-26-29(27)28(25-17-14-20-4-1-2-5-24(20)30(25)32-26)21-12-15-23(16-13-21)36-18-19-8-10-22(11-9-19)31(34)35/h1-2,4-5,8-17,28,32H,3,6-7,18H2,(H,34,35)
Standard InChI Key: OEWSFPVLNFZYKA-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
2.0085 -17.4953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0074 -18.3148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7154 -18.7238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4251 -18.3143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4223 -17.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7137 -17.0864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2994 -18.7229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5920 -18.3137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2987 -19.5400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1284 -17.0804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8377 -17.4864 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5438 -17.0751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2515 -17.4844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9572 -17.0738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9546 -16.2558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2403 -15.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5376 -16.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6602 -15.8436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0702 -15.0227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6509 -15.0260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3612 -14.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3639 -13.8049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6580 -13.3916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9477 -13.7985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9433 -14.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2348 -15.0261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0681 -15.8368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3663 -16.2482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3727 -17.0598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0802 -17.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7728 -16.2344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7790 -17.0437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4819 -17.4412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1790 -17.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1689 -16.2182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4655 -15.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 2 0
7 9 1 0
5 10 1 0
10 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
15 18 1 0
18 28 1 0
18 20 1 0
27 19 1 0
19 21 1 0
20 21 2 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
27 28 2 0
28 29 1 0
29 30 2 0
30 32 1 0
31 27 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 31 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 475.54Molecular Weight (Monoisotopic): 475.1784AlogP: 6.68#Rotatable Bonds: 5Polar Surface Area: 75.63Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.06CX Basic pKa: ┄CX LogP: 5.73CX LogD: 2.61Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.34Np Likeness Score: -0.45
References 1. Xiong H, Han J, Wang J, Lu W, Wang C, Chen Y, Fulin Lian, Zhang N, Liu YC, Zhang C, Ding H, Jiang H, Lu W, Luo C, Zhou B.. (2018) Discovery of 1,8-acridinedione derivatives as novel GCN5 inhibitors via high throughput screening., 151 [PMID:29665527 ] [10.1016/j.ejmech.2018.02.005 ]