Manool

ID: ALA4162501

Cas Number: 596-85-0

PubChem CID: 3034394

Max Phase: Preclinical

Molecular Formula: C20H34O

Molecular Weight: 290.49

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C[C@](C)(O)CC[C@H]1C(=C)CC[C@H]2C(C)(C)CCC[C@]12C

Standard InChI:  InChI=1S/C20H34O/c1-7-19(5,21)14-11-16-15(2)9-10-17-18(3,4)12-8-13-20(16,17)6/h7,16-17,21H,1-2,8-14H2,3-6H3/t16-,17-,19-,20+/m0/s1

Standard InChI Key:  CECREIRZLPLYDM-QGZVKYPTSA-N

Molfile:  

     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   30.5883   -2.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0049   -2.8959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4172   -2.1768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8716   -3.3084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8716   -4.1334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5835   -4.5418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5835   -2.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2956   -3.3084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2921   -4.1334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0009   -4.5466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7177   -4.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7212   -3.3145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1577   -4.5469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.0757   -2.5084    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   30.2841   -4.9543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5757   -5.3668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8573   -5.7725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8495   -6.5975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1311   -7.0032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0590   -7.3918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.6424   -6.3793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1233   -7.8282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  7  1  0
  5  6  1  0
  6  9  1  0
  8  7  1  0
  8  9  1  0
  8  2  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  2  1  0
  5 13  2  0
  8 14  1  6
  9 15  1  1
  6 16  1  1
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  1
 18 21  1  0
 19 22  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4162501

    Manool

Associated Targets(Human)

HL (112 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Chlamydia pneumoniae (241 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
B16-F10 (4610 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 290.49Molecular Weight (Monoisotopic): 290.2610AlogP: 5.50#Rotatable Bonds: 4
Polar Surface Area: 20.23Molecular Species: NEUTRALHBA: 1HBD: 1
#RO5 Violations: 1HBA (Lipinski): 1HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.30CX LogD: 5.30
Aromatic Rings: Heavy Atoms: 21QED Weighted: 0.68Np Likeness Score: 3.23

References

1. Karhu E, Isojärvi J, Vuorela P, Hanski L, Fallarero A..  (2017)  Identification of Privileged Antichlamydial Natural Products by a Ligand-Based Strategy.,  80  (10): [PMID:29043803] [10.1021/acs.jnatprod.6b01052]
2. Nicolella HD, Ribeiro AB, Melo MRS, Ozelin SD, Domingos da Silva LH, Sola Veneziani RC, Crispim Tavares D..  (2022)  Antitumor Effect of Manool in a Murine Melanoma Model.,  85  (2.0): [PMID:35157797] [10.1021/acs.jnatprod.1c01128]

Source