The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-(3,4-dimethoxyphenyl)-8-ethyl-2-oxo-2H-chromen-6-yl)-3-methyl-2,3-dihydroquinazolin-4(1h)-one ID: ALA4163051
PubChem CID: 145960556
Max Phase: Preclinical
Molecular Formula: C27H22N2O5
Molecular Weight: 454.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCc1cc(C2Nc3ccccc3C(=O)N2C)cc2cc(-c3ccc4c(c3)OCO4)c(=O)oc12
Standard InChI: InChI=1S/C27H22N2O5/c1-3-15-10-18(25-28-21-7-5-4-6-19(21)26(30)29(25)2)11-17-12-20(27(31)34-24(15)17)16-8-9-22-23(13-16)33-14-32-22/h4-13,25,28H,3,14H2,1-2H3
Standard InChI Key: DHHLLLFUOZDNHS-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
17.5063 -8.8941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5051 -9.7137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2132 -10.1226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2114 -8.4853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9200 -8.8905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9189 -9.7112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6251 -10.1202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3369 -9.7132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3381 -8.8925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6274 -8.4789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0433 -10.1199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0397 -10.9382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7454 -11.3487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7486 -9.7138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0468 -8.4857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8006 -10.1194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0934 -9.7081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3875 -10.1127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8020 -10.9353 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0899 -11.3415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3868 -10.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6803 -11.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6756 -12.1466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3833 -12.5571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0869 -12.1521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0960 -8.8909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6806 -9.7027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2090 -7.6681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9154 -7.2574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4549 -10.1206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4561 -10.9385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2343 -11.1903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7142 -10.5278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2325 -9.8669 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
11 12 2 0
12 13 1 0
13 31 2 0
30 14 2 0
14 11 1 0
8 11 1 0
9 15 2 0
16 17 1 0
16 19 1 0
17 18 1 0
18 21 1 0
20 19 1 0
2 16 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
17 26 1 0
18 27 2 0
4 28 1 0
28 29 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.48Molecular Weight (Monoisotopic): 454.1529AlogP: 4.95#Rotatable Bonds: 3Polar Surface Area: 81.01Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.47CX Basic pKa: ┄CX LogP: 5.33CX LogD: 5.33Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.44Np Likeness Score: -0.18
References 1. Singh LR, Kumar A, Upadhyay A, Gupta S, Palanati GR, Sikka K, Siddiqi MI, Yadav PN, Sashidhara KV.. (2018) Discovery of coumarin-dihydroquinazolinone analogs as niacin receptor 1 agonist with in-vivo anti-obesity efficacy., 152 [PMID:29709786 ] [10.1016/j.ejmech.2018.04.037 ]