The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
17alpha-Azidomethyl-3-benzyloxyestra-1,3,5(10)-trien-17beta-ol ID: ALA4163777
PubChem CID: 145957063
Max Phase: Preclinical
Molecular Formula: C26H31N3O2
Molecular Weight: 417.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@]12CC[C@@H]3c4ccc(OCc5ccccc5)cc4CC[C@H]3[C@@H]1CC[C@@]2(O)CN=[N+]=[N-]
Standard InChI: InChI=1S/C26H31N3O2/c1-25-13-11-22-21-10-8-20(31-16-18-5-3-2-4-6-18)15-19(21)7-9-23(22)24(25)12-14-26(25,30)17-28-29-27/h2-6,8,10,15,22-24,30H,7,9,11-14,16-17H2,1H3/t22-,23-,24+,25+,26-/m1/s1
Standard InChI Key: VJQWSWGMQQNCRU-PUHDZGQXSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
7.7657 -15.8766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7699 -16.7002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4810 -16.2849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4025 -18.1684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4025 -18.9963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1174 -19.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1174 -17.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8282 -18.1684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8247 -18.9962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5364 -19.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2561 -19.0022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5433 -17.7575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2557 -18.1770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2726 -16.5253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5487 -16.9324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9849 -16.9491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9760 -17.7734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7574 -18.0353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2509 -17.3729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6856 -19.4132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2475 -17.3491 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.9796 -16.1179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5362 -18.5845 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.9712 -18.6011 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.4769 -15.4613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4726 -14.6377 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4645 -13.8135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9711 -19.0037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2592 -19.4178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5437 -19.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1676 -19.4243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1654 -20.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5542 -20.6579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2627 -20.2422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 1
4 5 1 0
4 7 2 0
5 6 2 0
6 9 1 0
8 7 1 0
8 9 2 0
8 12 1 0
9 10 1 0
10 11 1 0
11 13 1 0
12 13 1 0
12 15 1 0
13 17 1 0
16 14 1 0
14 15 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 2 1 0
2 16 1 0
5 20 1 0
13 21 1 1
16 22 1 1
12 23 1 6
17 24 1 6
1 25 1 0
25 26 2 0
26 27 2 0
20 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
M CHG 2 26 1 27 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 417.55Molecular Weight (Monoisotopic): 417.2416AlogP: 6.16#Rotatable Bonds: 5Polar Surface Area: 78.22Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.81CX Basic pKa: ┄CX LogP: 5.67CX LogD: 5.56Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.36Np Likeness Score: 0.96
References 1. Romero-Hernández LL, Merino-Montiel P, Meza-Reyes S, Vega-Baez JL, López Ó, Padrón JM, Montiel-Smith S.. (2018) Synthesis of unprecedented steroidal spiro heterocycles as potential antiproliferative drugs., 143 [PMID:29172080 ] [10.1016/j.ejmech.2017.10.063 ]