The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-Methoxybenzyl 2-(2-((S)-6-amino-3-((S)-2-amino-4-methylpentanamido)hexanoyl)-1-methylhydrazinyl)acetate ID: ALA4163840
PubChem CID: 145959778
Max Phase: Preclinical
Molecular Formula: C23H39N5O5
Molecular Weight: 465.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(COC(=O)CN(C)NC(=O)C[C@H](CCCN)NC(=O)[C@@H](N)CC(C)C)c1
Standard InChI: InChI=1S/C23H39N5O5/c1-16(2)11-20(25)23(31)26-18(8-6-10-24)13-21(29)27-28(3)14-22(30)33-15-17-7-5-9-19(12-17)32-4/h5,7,9,12,16,18,20H,6,8,10-11,13-15,24-25H2,1-4H3,(H,26,31)(H,27,29)/t18-,20-/m0/s1
Standard InChI Key: MQPMNTMLCALFQY-ICSRJNTNSA-N
Molfile:
RDKit 2D
33 33 0 0 0 0 0 0 0 0999 V2000
5.0847 -22.3035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7925 -21.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5002 -22.3035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2079 -21.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9156 -22.3035 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.2079 -21.0778 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7925 -21.0778 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3770 -21.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6693 -22.3035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9616 -21.8949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6233 -21.8949 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3310 -22.3035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6233 -21.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0387 -21.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7464 -22.3035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0387 -21.0778 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0847 -20.6692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0847 -19.8520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3770 -21.0778 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3770 -19.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4541 -21.8949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1618 -22.3035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1602 -23.1218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8671 -23.5303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5757 -23.1217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5731 -22.3002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8657 -21.8954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3770 -18.6262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6693 -18.2176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0847 -18.2176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7925 -19.4434 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2794 -21.8892 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.9885 -22.2953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
4 6 2 0
2 7 1 6
1 8 1 0
8 9 1 0
9 10 1 0
5 11 1 0
11 12 1 0
11 13 1 0
12 14 1 0
14 15 1 0
14 16 2 0
7 17 1 0
17 18 1 0
17 19 2 0
18 20 1 0
15 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
20 28 1 0
28 29 1 0
28 30 1 0
18 31 1 6
26 32 1 0
32 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.60Molecular Weight (Monoisotopic): 465.2951AlogP: 0.69#Rotatable Bonds: 15Polar Surface Area: 149.01Molecular Species: BASEHBA: 8HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.18CX Basic pKa: 9.90CX LogP: -0.10CX LogD: -3.56Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.22Np Likeness Score: 0.03
References 1. Taguchi A, Hamada K, Shiozuka M, Kobayashi M, Murakami S, Takayama K, Taniguchi A, Usui T, Matsuda R, Hayashi Y.. (2017) Structure-Activity Relationship Study of Leucyl-3-epi-deoxynegamycin for Potent Premature Termination Codon Readthrough., 8 (10): [PMID:29057051 ] [10.1021/acsmedchemlett.7b00269 ]