The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-(4-methoxyphenyl)-8-methyl-2-oxo-2hechromen-6-yl)-3-methyl-2,3-dihydroquinazolin-4(1H)-one ID: ALA4164140
PubChem CID: 145957566
Max Phase: Preclinical
Molecular Formula: C26H22N2O4
Molecular Weight: 426.47
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cc3cc(C4Nc5ccccc5C(=O)N4C)cc(C)c3oc2=O)cc1
Standard InChI: InChI=1S/C26H22N2O4/c1-15-12-18(24-27-22-7-5-4-6-20(22)25(29)28(24)2)13-17-14-21(26(30)32-23(15)17)16-8-10-19(31-3)11-9-16/h4-14,24,27H,1-3H3
Standard InChI Key: RWDKPYFVKVENAZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
5.0132 -13.6528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0120 -14.4724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7201 -14.8813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7183 -13.2440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4269 -13.6492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4257 -14.4699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1319 -14.8789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8438 -14.4719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8450 -13.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1342 -13.2376 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5502 -14.8786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5466 -15.6969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2523 -16.1074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9621 -15.7007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9618 -14.8793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2555 -14.4725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5537 -13.2444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3075 -14.8781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6003 -14.4668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8944 -14.8714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3088 -15.6940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5967 -16.1002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8937 -15.6879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1872 -16.0905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1825 -16.9053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8902 -17.3158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5938 -16.9108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6029 -13.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1875 -14.4613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7158 -12.4268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6693 -16.1104 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6681 -16.9276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
8 11 1 0
9 17 2 0
18 19 1 0
18 21 1 0
19 20 1 0
20 23 1 0
22 21 1 0
2 18 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
19 28 1 0
20 29 2 0
4 30 1 0
14 31 1 0
31 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.47Molecular Weight (Monoisotopic): 426.1580AlogP: 4.97#Rotatable Bonds: 3Polar Surface Area: 71.78Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.47CX Basic pKa: ┄CX LogP: 5.11CX LogD: 5.11Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.47Np Likeness Score: -0.38
References 1. Singh LR, Kumar A, Upadhyay A, Gupta S, Palanati GR, Sikka K, Siddiqi MI, Yadav PN, Sashidhara KV.. (2018) Discovery of coumarin-dihydroquinazolinone analogs as niacin receptor 1 agonist with in-vivo anti-obesity efficacy., 152 [PMID:29709786 ] [10.1016/j.ejmech.2018.04.037 ]