2-(3-(4-methoxyphenyl)-8-methyl-2-oxo-2hechromen-6-yl)-3-methyl-2,3-dihydroquinazolin-4(1H)-one

ID: ALA4164140

PubChem CID: 145957566

Max Phase: Preclinical

Molecular Formula: C26H22N2O4

Molecular Weight: 426.47

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2cc3cc(C4Nc5ccccc5C(=O)N4C)cc(C)c3oc2=O)cc1

Standard InChI:  InChI=1S/C26H22N2O4/c1-15-12-18(24-27-22-7-5-4-6-20(22)25(29)28(24)2)13-17-14-21(26(30)32-23(15)17)16-8-10-19(31-3)11-9-16/h4-14,24,27H,1-3H3

Standard InChI Key:  RWDKPYFVKVENAZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    5.0132  -13.6528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0120  -14.4724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7201  -14.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7183  -13.2440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4269  -13.6492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4257  -14.4699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1319  -14.8789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8438  -14.4719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8450  -13.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1342  -13.2376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5502  -14.8786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5466  -15.6969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2523  -16.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9621  -15.7007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9618  -14.8793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2555  -14.4725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5537  -13.2444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3075  -14.8781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6003  -14.4668    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8944  -14.8714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3088  -15.6940    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5967  -16.1002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8937  -15.6879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1872  -16.0905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1825  -16.9053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8902  -17.3158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5938  -16.9108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6029  -13.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1875  -14.4613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7158  -12.4268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6693  -16.1104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6681  -16.9276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  8 11  1  0
  9 17  2  0
 18 19  1  0
 18 21  1  0
 19 20  1  0
 20 23  1  0
 22 21  1  0
  2 18  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 19 28  1  0
 20 29  2  0
  4 30  1  0
 14 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4164140

    ---

Associated Targets(Human)

HCAR2 Tclin Hydroxycarboxylic acid receptor 2 (1903 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 426.47Molecular Weight (Monoisotopic): 426.1580AlogP: 4.97#Rotatable Bonds: 3
Polar Surface Area: 71.78Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 12.47CX Basic pKa: CX LogP: 5.11CX LogD: 5.11
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.47Np Likeness Score: -0.38

References

1. Singh LR, Kumar A, Upadhyay A, Gupta S, Palanati GR, Sikka K, Siddiqi MI, Yadav PN, Sashidhara KV..  (2018)  Discovery of coumarin-dihydroquinazolinone analogs as niacin receptor 1 agonist with in-vivo anti-obesity efficacy.,  152  [PMID:29709786] [10.1016/j.ejmech.2018.04.037]

Source