The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-Chloro-N4-(2-(isopropylsulfonyl)phenyl)-N2-(2-methoxy-4-(4-(pyrrolidin-1-ylmethyl)thiazol-2-yl)phenyl)pyrimidine-2,4-diamine ID: ALA4164390
PubChem CID: 145960051
Max Phase: Preclinical
Molecular Formula: C28H31ClN6O3S2
Molecular Weight: 599.18
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(-c2nc(CN3CCCC3)cs2)ccc1Nc1ncc(Cl)c(Nc2ccccc2S(=O)(=O)C(C)C)n1
Standard InChI: InChI=1S/C28H31ClN6O3S2/c1-18(2)40(36,37)25-9-5-4-8-23(25)32-26-21(29)15-30-28(34-26)33-22-11-10-19(14-24(22)38-3)27-31-20(17-39-27)16-35-12-6-7-13-35/h4-5,8-11,14-15,17-18H,6-7,12-13,16H2,1-3H3,(H2,30,32,33,34)
Standard InChI Key: FGVMJPCJSJLWAZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
9.2698 -3.9745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8653 -4.6844 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.6823 -4.6797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.4075 -8.3490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5873 -8.3442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7605 -6.3896 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.0812 -6.8491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3083 -7.6372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1280 -7.6647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4075 -6.8937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3096 -6.5699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2881 -5.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5674 -5.3587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8681 -5.7873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8895 -6.6071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6103 -6.9985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5459 -4.5388 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8251 -4.1475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1473 -5.3959 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4480 -5.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7272 -5.4331 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0279 -5.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0494 -6.6815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7702 -7.0729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4695 -6.6443 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3071 -5.4703 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6078 -5.8988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8871 -5.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1878 -5.9360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2092 -6.7559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9300 -7.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6293 -6.7187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1691 -4.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4481 -4.6479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1911 -3.4371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3501 -7.1101 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
19.0749 -7.8640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6624 -9.1335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4874 -9.1335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7423 -8.3490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
6 10 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
11 16 2 0
17 18 1 0
13 17 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
20 25 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
27 32 2 0
33 34 1 0
33 35 1 0
2 33 1 0
28 2 1 0
26 27 1 0
22 26 1 0
23 36 1 0
19 20 1 0
14 19 1 0
7 11 1 0
5 9 1 0
4 5 1 0
37 4 1 0
4 38 1 0
38 39 1 0
39 40 1 0
37 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 599.18Molecular Weight (Monoisotopic): 598.1588AlogP: 6.53#Rotatable Bonds: 10Polar Surface Area: 109.34Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.46CX Basic pKa: 7.54CX LogP: 5.68CX LogD: 5.31Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.21Np Likeness Score: -1.95
References 1. Wang Y, Chen S, Hu G, Wang J, Gou W, Zuo D, Gu Y, Gong P, Zhai X.. (2018) Discovery of novel 2,4-diarylaminopyrimidine analogues as ALK and ROS1 dual inhibitors to overcome crizotinib-resistant mutants including G1202R., 143 [PMID:29174809 ] [10.1016/j.ejmech.2017.11.008 ]