The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-(2-(Hydroxymethyl)-4-((1-methyl-5-nitro-1H-indol-3-yl)-methylene)-5-oxotetrahydrofuran-2-yl)methyl Pivalate ID: ALA4164472
PubChem CID: 145959564
Max Phase: Preclinical
Molecular Formula: C21H24N2O7
Molecular Weight: 416.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cc(/C=C2/CC(CO)(COC(=O)C(C)(C)C)OC2=O)c2cc([N+](=O)[O-])ccc21
Standard InChI: InChI=1S/C21H24N2O7/c1-20(2,3)19(26)29-12-21(11-24)9-13(18(25)30-21)7-14-10-22(4)17-6-5-15(23(27)28)8-16(14)17/h5-8,10,24H,9,11-12H2,1-4H3/b13-7-
Standard InChI Key: LWIQJWIQVPZBME-QPEQYQDCSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
3.4710 -22.5223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1850 -22.1178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4757 -21.7011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4387 -22.8998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2601 -22.8998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5144 -22.1189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8515 -21.6327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2961 -21.8675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6646 -23.6096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4663 -23.3436 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7615 -22.1098 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0520 -21.6931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3379 -22.1018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0567 -20.8718 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6317 -21.6904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3347 -22.9189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6273 -22.5058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4817 -23.6142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7424 -23.2094 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9666 -22.9526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7378 -24.0266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9584 -24.2716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7823 -25.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3846 -25.6192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1657 -25.3694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3382 -24.5741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2094 -26.4174 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4062 -22.7327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8135 -26.9731 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4310 -26.6697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 2 1 0
2 4 1 0
6 8 2 0
5 9 2 0
1 10 1 0
3 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
13 16 1 0
13 17 1 0
9 18 1 0
18 22 1 0
21 19 1 0
19 20 1 0
20 18 2 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
24 27 1 0
19 28 1 0
27 29 2 0
27 30 1 0
M CHG 2 27 1 30 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 416.43Molecular Weight (Monoisotopic): 416.1584AlogP: 2.74#Rotatable Bonds: 5Polar Surface Area: 120.90Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.54CX LogD: 3.54Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.34Np Likeness Score: -0.09
References 1. Ann J, Czikora A, Saini AS, Zhou X, Mitchell GA, Lewin NE, Peach ML, Blumberg PM, Lee J.. (2018) α-Arylidene Diacylglycerol-Lactones (DAG-Lactones) as Selective Ras Guanine-Releasing Protein 3 (RasGRP3) Ligands., 61 (14): [PMID:29860841 ] [10.1021/acs.jmedchem.8b00661 ]