5-(Naphthalen-1-yl)-3-(beta-D-glucopyranosyl)-1,2,4-triazole

ID: ALA4164542

PubChem CID: 132281934

Max Phase: Preclinical

Molecular Formula: C18H19N3O5

Molecular Weight: 357.37

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  OC[C@H]1O[C@@H](c2nc(-c3cccc4ccccc34)n[nH]2)[C@H](O)[C@@H](O)[C@@H]1O

Standard InChI:  InChI=1S/C18H19N3O5/c22-8-12-13(23)14(24)15(25)16(26-12)18-19-17(20-21-18)11-7-3-5-9-4-1-2-6-10(9)11/h1-7,12-16,22-25H,8H2,(H,19,20,21)/t12-,13-,14+,15-,16-/m1/s1

Standard InChI Key:  UGWCMNZLMGJTJS-IBEHDNSVSA-N

Molfile:  

     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
   28.8436   -4.3336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1345   -4.7422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1345   -5.5594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8436   -5.9680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4254   -5.9680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4254   -6.7852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7163   -5.5594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0114   -5.9680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7163   -4.7463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4254   -4.3377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0114   -4.3336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0114   -3.5205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.5902   -4.6618    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.1383   -4.0541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7297   -3.3449    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.9291   -3.5145    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.9486   -4.1406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.2796   -4.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0915   -4.9753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.5732   -4.3141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4265   -3.4818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2367   -3.5666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7134   -2.9082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.3810   -2.1647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5673   -2.0835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0942   -2.7428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  2  3  1  0
  3  4  1  6
  3  5  1  0
  5  6  1  1
  5  7  1  0
  7  8  1  6
  7  9  1  0
  9 10  1  0
  9 11  1  1
 11 12  1  0
  2 10  1  0
  1 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16  1  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 22  1  0
 21 17  1  0
 14 17  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 21  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4164542

    ---

Associated Targets(Human)

PYGL Tchem Liver glycogen phosphorylase (1040 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

PYGM Glycogen phosphorylase, muscle form (1331 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 357.37Molecular Weight (Monoisotopic): 357.1325AlogP: 0.14#Rotatable Bonds: 3
Polar Surface Area: 131.72Molecular Species: NEUTRALHBA: 7HBD: 5
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 9.41CX Basic pKa: 0.46CX LogP: 0.45CX LogD: 0.44
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.45Np Likeness Score: 0.27

References

1. Kun S, Begum J, Kyriakis E, Stamati ECV, Barkas TA, Szennyes E, Bokor É, Szabó KE, Stravodimos GA, Sipos Á, Docsa T, Gergely P, Moffatt C, Patraskaki MS, Kokolaki MC, Gkerdi A, Skamnaki VT, Leonidas DD, Somsák L, Hayes JM..  (2018)  A multidisciplinary study of 3-(β-d-glucopyranosyl)-5-substituted-1,2,4-triazole derivatives as glycogen phosphorylase inhibitors: Computation, synthesis, crystallography and kinetics reveal new potent inhibitors.,  147  [PMID:29453094] [10.1016/j.ejmech.2018.01.095]

Source