The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
11alpha-(4-(4-(4-methylpiperazin-1-yl)acetamido)benzoyl)oxy-3,17beta-dihydroxyestra-1,3,5(10)-triene ID: ALA4165547
PubChem CID: 145954696
Max Phase: Preclinical
Molecular Formula: C32H41N3O5
Molecular Weight: 547.70
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(CC(=O)Nc2ccc(C(=O)O[C@@H]3C[C@]4(C)[C@@H](O)CC[C@H]4[C@@H]4CCc5cc(O)ccc5[C@H]43)cc2)CC1
Standard InChI: InChI=1S/C32H41N3O5/c1-32-18-27(30-24-10-8-23(36)17-21(24)5-9-25(30)26(32)11-12-28(32)37)40-31(39)20-3-6-22(7-4-20)33-29(38)19-35-15-13-34(2)14-16-35/h3-4,6-8,10,17,25-28,30,36-37H,5,9,11-16,18-19H2,1-2H3,(H,33,38)/t25-,26-,27+,28-,30+,32-/m0/s1
Standard InChI Key: GEEMMPAISCQJEG-FCLURFJZSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
32.8940 -20.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8858 -21.3873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1759 -21.7876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4701 -21.3749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7644 -21.7835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7561 -22.6007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1883 -20.1491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4742 -20.5577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.1800 -22.6048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6617 -21.6391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0504 -21.3749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6741 -20.3225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4701 -23.0134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0586 -23.0134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1487 -20.9828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3446 -22.6048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3446 -21.7876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.8858 -19.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9258 -19.5424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.6388 -23.0134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.1676 -20.9704 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
31.4619 -22.1921 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
32.8858 -22.1962 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
30.7684 -20.1460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.7720 -19.3288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0661 -18.9171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.4815 -18.9234 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.0717 -18.1008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3667 -17.6892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6562 -18.0947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6552 -18.9161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3608 -19.3240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9497 -17.6839 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.9523 -16.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2458 -16.4559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.6613 -16.4603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6638 -15.6431 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.3777 -15.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3822 -14.4228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6776 -14.0081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.9668 -14.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9607 -15.2331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6833 -13.1910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 8 1 0
5 4 1 0
6 5 2 0
7 1 1 0
8 7 1 0
9 3 1 0
10 2 1 0
11 5 1 0
12 1 1 0
13 9 1 0
14 6 1 0
15 12 1 0
16 17 1 0
17 11 2 0
1 18 1 1
12 19 1 1
20 16 1 0
3 21 1 1
4 22 1 6
2 23 1 6
10 15 1 0
3 4 1 0
6 13 1 0
14 16 2 0
8 24 1 6
24 25 1 0
25 26 1 0
25 27 2 0
26 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 26 1 0
30 33 1 0
33 34 1 0
34 35 2 0
34 36 1 0
36 37 1 0
37 38 1 0
37 42 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
40 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 547.70Molecular Weight (Monoisotopic): 547.3046AlogP: 3.63#Rotatable Bonds: 5Polar Surface Area: 102.34Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.59CX Basic pKa: 7.20CX LogP: 3.91CX LogD: 3.69Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.49Np Likeness Score: 0.49
References 1. Lao K, Wang Y, Chen M, Zhang J, You Q, Xiang H.. (2017) Design, synthesis and biological evaluation of novel 2-methoxyestradiol analogs as dual selective estrogen receptor modulators (SERMs) and antiangiogenic agents., 139 [PMID:28810190 ] [10.1016/j.ejmech.2017.08.016 ]