The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-4-(7-methoxy-6-(3-methylbut-2-enyl)-4-oxochroman-2-yl)phenyl 4-nitrobenzoate ID: ALA4165577
PubChem CID: 145956096
Max Phase: Preclinical
Molecular Formula: C28H25NO7
Molecular Weight: 487.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1CC=C(C)C)C(=O)C[C@@H](c1ccc(OC(=O)c3ccc([N+](=O)[O-])cc3)cc1)O2
Standard InChI: InChI=1S/C28H25NO7/c1-17(2)4-5-20-14-23-24(30)15-26(36-27(23)16-25(20)34-3)18-8-12-22(13-9-18)35-28(31)19-6-10-21(11-7-19)29(32)33/h4,6-14,16,26H,5,15H2,1-3H3/t26-/m0/s1
Standard InChI Key: LIWUKYBQZUOKDO-SANMLTNESA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
10.8733 -3.7596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1443 -5.4041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1432 -6.2314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8580 -6.6443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8562 -4.9913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5715 -5.4004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5704 -6.2335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2873 -6.6487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0099 -6.2355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0111 -5.4025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2896 -4.9826 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4298 -4.9918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2849 -7.4737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7249 -4.9943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4386 -5.4103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1536 -5.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1560 -4.1744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4375 -3.7603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7255 -4.1727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4284 -6.6433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7142 -6.2303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9995 -6.6422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2853 -6.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9988 -7.4672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4296 -4.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5880 -4.1716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3023 -3.7586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5886 -4.9966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0150 -4.1755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7287 -3.7632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7286 -2.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0089 -2.5255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2980 -2.9402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4451 -2.5225 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4434 -1.6975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1604 -2.9336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
6 11 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
2 12 1 0
8 13 2 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
10 14 1 6
17 1 1 0
3 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
22 24 1 0
12 25 1 0
1 26 1 0
26 27 1 0
26 28 2 0
27 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 27 1 0
34 35 2 0
34 36 1 0
31 34 1 0
M CHG 2 34 1 36 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.51Molecular Weight (Monoisotopic): 487.1631AlogP: 6.04#Rotatable Bonds: 7Polar Surface Area: 104.97Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.27CX LogD: 6.27Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.13Np Likeness Score: 0.63
References 1. Gupta N, Qayum A, Raina A, Shankar R, Gairola S, Singh S, Sangwan PL.. (2018) Synthesis and biological evaluation of novel bavachinin analogs as anticancer agents., 145 [PMID:29335212 ] [10.1016/j.ejmech.2018.01.006 ]