(S)-4-(7-methoxy-6-(3-methylbut-2-enyl)-4-oxochroman-2-yl)phenyl 4-nitrobenzoate

ID: ALA4165577

PubChem CID: 145956096

Max Phase: Preclinical

Molecular Formula: C28H25NO7

Molecular Weight: 487.51

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2c(cc1CC=C(C)C)C(=O)C[C@@H](c1ccc(OC(=O)c3ccc([N+](=O)[O-])cc3)cc1)O2

Standard InChI:  InChI=1S/C28H25NO7/c1-17(2)4-5-20-14-23-24(30)15-26(36-27(23)16-25(20)34-3)18-8-12-22(13-9-18)35-28(31)19-6-10-21(11-7-19)29(32)33/h4,6-14,16,26H,5,15H2,1-3H3/t26-/m0/s1

Standard InChI Key:  LIWUKYBQZUOKDO-SANMLTNESA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   10.8733   -3.7596    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1443   -5.4041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1432   -6.2314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8580   -6.6443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8562   -4.9913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5715   -5.4004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5704   -6.2335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2873   -6.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0099   -6.2355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0111   -5.4025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2896   -4.9826    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4298   -4.9918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2849   -7.4737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7249   -4.9943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4386   -5.4103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1536   -5.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1560   -4.1744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4375   -3.7603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7255   -4.1727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4284   -6.6433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7142   -6.2303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9995   -6.6422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2853   -6.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9988   -7.4672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4296   -4.1668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5880   -4.1716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3023   -3.7586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5886   -4.9966    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0150   -4.1755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7287   -3.7632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7286   -2.9374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0089   -2.5255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2980   -2.9402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4451   -2.5225    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4434   -1.6975    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1604   -2.9336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  7  2  0
  6  5  2  0
  5  2  1  0
  6  7  1  0
  6 11  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  2 12  1  0
  8 13  2  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 10 14  1  6
 17  1  1  0
  3 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 22 24  1  0
 12 25  1  0
  1 26  1  0
 26 27  1  0
 26 28  2  0
 27 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 27  1  0
 34 35  2  0
 34 36  1  0
 31 34  1  0
M  CHG  2  34   1  36  -1
M  END

Alternative Forms

  1. Parent:

    ALA4165577

    ---

Associated Targets(non-human)

Pparg Peroxisome proliferator-activated receptor gamma (748 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.51Molecular Weight (Monoisotopic): 487.1631AlogP: 6.04#Rotatable Bonds: 7
Polar Surface Area: 104.97Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.27CX LogD: 6.27
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.13Np Likeness Score: 0.63

References

1. Gupta N, Qayum A, Raina A, Shankar R, Gairola S, Singh S, Sangwan PL..  (2018)  Synthesis and biological evaluation of novel bavachinin analogs as anticancer agents.,  145  [PMID:29335212] [10.1016/j.ejmech.2018.01.006]

Source