2-O-lauroyl lycorine

ID: ALA4165636

PubChem CID: 66561972

Max Phase: Preclinical

Molecular Formula: C28H39NO5

Molecular Weight: 469.62

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCC(=O)O[C@H]1C=C2CCN3Cc4cc5c(cc4[C@H]([C@@H]1O)[C@@H]23)OCO5

Standard InChI:  InChI=1S/C28H39NO5/c1-2-3-4-5-6-7-8-9-10-11-25(30)34-24-14-19-12-13-29-17-20-15-22-23(33-18-32-22)16-21(20)26(27(19)29)28(24)31/h14-16,24,26-28,31H,2-13,17-18H2,1H3/t24-,26-,27+,28+/m0/s1

Standard InChI Key:  JRYFXBLEYWMOET-GDWZEYGFSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   14.5945   -7.1860    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0152   -7.1943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0164   -9.6551    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5986   -9.6569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0152   -6.3775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3091   -8.4277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9698   -8.1556    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.1862   -8.8361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5986   -8.8361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3091   -7.6027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8924   -8.4277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7932   -9.9069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3368   -8.9806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7256   -8.4277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1862   -9.6569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4073   -8.5811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0986   -9.2156    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   16.7256   -7.6027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9304   -9.2486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4071   -9.9078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0152   -8.8361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3091  -10.0654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8924  -10.0654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5404   -6.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2462   -5.9927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9520   -6.3972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6577   -5.9886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3635   -6.3931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0692   -5.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7750   -6.3889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4807   -5.9804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1865   -6.3848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8923   -5.9762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5980   -6.3807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3044   -5.9698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3018   -5.1527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 21  7  1  6
  3 22  1  0
 13 12  1  0
  6 17  1  1
 18 14  2  0
 21  6  1  0
 11  8  1  0
  2 18  1  0
 19 16  1  0
 20 19  1  0
 15 23  1  0
 11  9  2  0
  9  6  1  0
  4  9  1  0
 14 13  1  0
 10  1  1  6
  8 15  2  0
 15 20  1  0
  2  5  1  1
 21  3  1  0
  8 16  1  0
  3 12  1  0
 23  4  2  0
  6 10  1  0
 10  2  1  0
 22  4  1  0
 14 21  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35  5  1  0
 35 36  2  0
M  END

Associated Targets(non-human)

Trichomonas vaginalis (2376 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 469.62Molecular Weight (Monoisotopic): 469.2828AlogP: 5.22#Rotatable Bonds: 11
Polar Surface Area: 68.23Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.70CX Basic pKa: 8.07CX LogP: 5.31CX LogD: 4.55
Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.27Np Likeness Score: 1.61

References

1. Bala V, Chhonker YS..  (2018)  Recent developments in anti-Trichomonas research: An update review.,  143  [PMID:29175675] [10.1016/j.ejmech.2017.11.029]
2. Nair JJ, van Staden J..  (2019)  Antiprotozoal alkaloid principles of the plant family Amaryllidaceae.,  29  (20): [PMID:31515186] [10.1016/j.bmcl.2019.126642]

Source