The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(5-Chloro-2-(2,4-dichlorophenoxy)phenoxy)propyl(E)-3-(3,4-bis((tert-butyldimethylsilyl)oxy)phenyl)prop-2-enoate ID: ALA4165806
PubChem CID: 145954703
Max Phase: Preclinical
Molecular Formula: C33H29Cl3O6
Molecular Weight: 627.95
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C/C(=O)c2ccc(OCCCCOc3cc(Cl)ccc3Oc3ccc(Cl)cc3Cl)cc2)cc1OC
Standard InChI: InChI=1S/C33H29Cl3O6/c1-38-30-14-6-22(19-32(30)39-2)5-13-28(37)23-7-11-26(12-8-23)40-17-3-4-18-41-33-21-25(35)10-16-31(33)42-29-15-9-24(34)20-27(29)36/h5-16,19-21H,3-4,17-18H2,1-2H3/b13-5+
Standard InChI Key: SBMSGHPSBSCDOX-WLRTZDKTSA-N
Molfile:
RDKit 2D
42 45 0 0 0 0 0 0 0 0999 V2000
12.6950 -21.0854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4012 -20.6696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3932 -19.8520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6798 -19.4492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9729 -19.8700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9843 -20.6862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1254 -21.0690 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.2519 -19.4661 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2473 -18.6502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9569 -18.2393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9596 -17.4194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2469 -17.0122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5437 -17.4207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5446 -18.2402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2468 -16.1914 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.8274 -18.6612 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1117 -18.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4032 -18.6733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6875 -18.2749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9832 -18.6936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2692 -18.2933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5617 -18.7162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8529 -18.3087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1449 -18.7240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1587 -19.5445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8704 -19.9473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5731 -19.5342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4424 -19.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7263 -19.5629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4546 -20.7878 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0223 -19.9767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3021 -19.5773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2892 -18.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5805 -18.3516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1334 -18.7818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1224 -19.5989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5953 -19.9980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8665 -18.3938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5611 -18.8313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8367 -20.0184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5542 -19.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6704 -18.6320 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
5 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
12 15 1 0
14 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
28 29 1 0
28 30 2 0
29 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
35 38 1 0
38 39 1 0
36 40 1 0
40 41 1 0
4 42 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 627.95Molecular Weight (Monoisotopic): 626.1030AlogP: 9.59#Rotatable Bonds: 14Polar Surface Area: 63.22Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 8.95CX LogD: 8.95Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.08Np Likeness Score: -0.47
References 1. Otero E, García E, Palacios G, Yepes LM, Carda M, Agut R, Vélez ID, Cardona WI, Robledo SM.. (2017) Triclosan-caffeic acid hybrids: Synthesis, leishmanicidal, trypanocidal and cytotoxic activities., 141 [PMID:29028533 ] [10.1016/j.ejmech.2017.09.064 ] 2. de Mello MVP, Abrahim-Vieira BA, Domingos TFS, de Jesus JB, de Sousa ACC, Rodrigues CR, Souza AMT.. (2018) A comprehensive review of chalcone derivatives as antileishmanial agents., 150 [PMID:29602038 ] [10.1016/j.ejmech.2018.03.047 ]