The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3,4-dimethoxybenzyl)-3-(1-((2-((1-(piperidin-4-yl)-1H-pyrazol-4-yl)amino)pyridin-4-yl)oxy)ethyl)benzamide ID: ALA4166182
PubChem CID: 141482492
Max Phase: Preclinical
Molecular Formula: C31H36N6O4
Molecular Weight: 556.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CNC(=O)c2cccc(C(C)Oc3ccnc(Nc4cnn(C5CCNCC5)c4)c3)c2)cc1OC
Standard InChI: InChI=1S/C31H36N6O4/c1-21(23-5-4-6-24(16-23)31(38)34-18-22-7-8-28(39-2)29(15-22)40-3)41-27-11-14-33-30(17-27)36-25-19-35-37(20-25)26-9-12-32-13-10-26/h4-8,11,14-17,19-21,26,32H,9-10,12-13,18H2,1-3H3,(H,33,36)(H,34,38)
Standard InChI Key: MFJZKVWCENDLCM-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
35.4141 -11.3579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4130 -12.1895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1320 -12.6064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.8525 -12.1890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8496 -11.3543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1301 -10.9452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5717 -12.6045 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.5731 -13.4336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9058 -13.9180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1620 -14.7063 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.9911 -14.7050 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.2447 -13.9159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6781 -15.3787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.1276 -10.1202 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.8408 -9.7056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.8384 -8.8807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5565 -10.1159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5568 -10.9383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2716 -11.3486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9859 -10.9338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9807 -10.1046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2653 -9.6981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6924 -9.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.4096 -10.0953 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.6871 -8.8625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.4150 -10.9203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1320 -11.3282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1346 -12.1507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8509 -12.5585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5636 -12.1412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5556 -11.3121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8387 -10.9080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8531 -15.2937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3698 -15.9620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.7063 -16.7192 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.5313 -16.8041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.0197 -16.1318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8559 -13.3835 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.2813 -12.5482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.1438 -13.8002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9924 -12.1301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
10 13 1 0
6 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
21 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
13 33 1 0
13 37 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
29 38 1 0
30 39 1 0
38 40 1 0
39 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 556.67Molecular Weight (Monoisotopic): 556.2798AlogP: 5.03#Rotatable Bonds: 11Polar Surface Area: 111.56Molecular Species: BASEHBA: 9HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.81CX Basic pKa: 10.12CX LogP: 3.33CX LogD: 0.69Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.24Np Likeness Score: -1.13
References 1. Tian Y, Zhang T, Long L, Li Z, Wan S, Wang G, Yu Y, Hou J, Wu X, Zhang J.. (2018) Design, synthesis, biological evaluation and molecular modeling of novel 2-amino-4-(1-phenylethoxy) pyridine derivatives as potential ROS1 inhibitors., 143 [PMID:29174814 ] [10.1016/j.ejmech.2017.11.002 ]