The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-3-((4-(3-((4-methylpiperazine-1-yl)methyl)-2-oxopyrrolidin-1-)phenylamino)(phenyl)methylene)-2-oxoindoline-6-carboxylate ID: ALA4166187
PubChem CID: 136299423
Max Phase: Preclinical
Molecular Formula: C33H35N5O4
Molecular Weight: 565.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc2c(c1)NC(=O)/C2=C(\Nc1ccc(N2CCC(CN3CCN(C)CC3)C2=O)cc1)c1ccccc1
Standard InChI: InChI=1S/C33H35N5O4/c1-36-16-18-37(19-17-36)21-24-14-15-38(32(24)40)26-11-9-25(10-12-26)34-30(22-6-4-3-5-7-22)29-27-13-8-23(33(41)42-2)20-28(27)35-31(29)39/h3-13,20,24,34H,14-19,21H2,1-2H3,(H,35,39)/b30-29-
Standard InChI Key: VPZDWQHUUTZTSQ-FLWNBWAVSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
5.1329 -14.8497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1317 -15.6693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8398 -16.0782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8380 -14.4409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5466 -14.8461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5514 -15.6693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3358 -15.9191 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8158 -15.2503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3280 -14.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6330 -15.2455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5759 -13.8086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3742 -13.6340 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0256 -13.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2770 -12.4274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7274 -11.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9281 -11.9980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6814 -12.7815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2326 -13.3819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4237 -16.0773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7163 -15.6681 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4230 -16.8945 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0083 -16.0762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6222 -12.8553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4192 -12.6842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3147 -11.4795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0704 -12.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1166 -11.3014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6657 -11.9058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3611 -10.5257 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1365 -10.2679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1310 -9.4508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3521 -9.2035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8763 -9.8679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0591 -9.8734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0942 -8.4280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6369 -7.8170 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4414 -7.9887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9831 -7.3816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7292 -6.6109 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9282 -6.4390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3811 -7.0485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2754 -6.0030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
8 10 2 0
9 11 2 0
11 12 1 0
11 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
2 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
12 23 1 0
23 24 2 0
24 28 1 0
27 25 1 0
25 26 2 0
26 23 1 0
27 28 2 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 29 1 0
27 29 1 0
33 34 2 0
32 35 1 0
35 36 1 0
36 37 1 0
36 41 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
39 42 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 565.67Molecular Weight (Monoisotopic): 565.2689AlogP: 4.01#Rotatable Bonds: 7Polar Surface Area: 94.22Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.86CX Basic pKa: 8.42CX LogP: 3.10CX LogD: 2.04Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.33Np Likeness Score: -0.82
References 1. Huang Z, Li H, Zhang Q, Lu F, Hong M, Zhang Z, Guo X, Zhu Y, Li S, Liu H.. (2017) Discovery of Indolinone-Based Multikinase Inhibitors as Potential Therapeutics for Idiopathic Pulmonary Fibrosis., 8 (11): [PMID:29152045 ] [10.1021/acsmedchemlett.7b00164 ] 2. Huang Z, Li H, Zhang Q, Lu F, Hong M, Zhang Z, Guo X, Zhu Y, Li S, Liu H.. (2017) Discovery of Indolinone-Based Multikinase Inhibitors as Potential Therapeutics for Idiopathic Pulmonary Fibrosis., 8 (11): [PMID:29152045 ] [10.1021/acsmedchemlett.7b00164 ] 3. Huang Z, Li H, Zhang Q, Lu F, Hong M, Zhang Z, Guo X, Zhu Y, Li S, Liu H.. (2017) Discovery of Indolinone-Based Multikinase Inhibitors as Potential Therapeutics for Idiopathic Pulmonary Fibrosis., 8 (11): [PMID:29152045 ] [10.1021/acsmedchemlett.7b00164 ]