Your company account is blocked and you cannot place orders. If you have questions, please contact your company administrator.

2-(2-Carboxy-1-(furan-2-yl)ethyl)-1,3-dioxoisoindoline-5-carboxylic acid

ID: ALA4166245

PubChem CID: 145953780

Max Phase: Preclinical

Molecular Formula: C16H11NO7

Molecular Weight: 329.26

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)CC(c1ccco1)N1C(=O)c2ccc(C(=O)O)cc2C1=O

Standard InChI:  InChI=1S/C16H11NO7/c18-13(19)7-11(12-2-1-5-24-12)17-14(20)9-4-3-8(16(22)23)6-10(9)15(17)21/h1-6,11H,7H2,(H,18,19)(H,22,23)

Standard InChI Key:  XZOMMULEAGQNTL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   10.7789  -15.1717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7778  -15.9912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4858  -16.4002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4840  -14.7628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1926  -15.1681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1975  -15.9912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9818  -16.2410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4618  -15.5722    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9740  -14.9092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2790  -15.5674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6918  -16.2727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6834  -14.8573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5006  -14.8524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9050  -14.1423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9134  -15.5577    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2389  -17.0167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2220  -14.1305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3683  -17.0195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9788  -17.5627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6842  -17.1499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5094  -16.3516    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0711  -14.7632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0709  -13.9460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3635  -15.1720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
  7 16  2  0
  9 17  2  0
 11 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 11  1  0
  1 22  1  0
 22 23  2  0
 22 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4166245

    ---

Associated Targets(non-human)

TCTS-154 Trans-sialidase (45 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Trypanosoma cruzi (99888 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Biocomponents

Calculated Properties

Molecular Weight: 329.26Molecular Weight (Monoisotopic): 329.0536AlogP: 1.79#Rotatable Bonds: 5
Polar Surface Area: 125.12Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.26CX Basic pKa: CX LogP: 1.13CX LogD: -5.40
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.80Np Likeness Score: -0.74

References

1. Kashif M, Chacón-Vargas KF, López-Cedillo JC, Nogueda-Torres B, Paz-González AD, Ramírez-Moreno E, Agusti R, Uhrig ML, Reyes-Arellano A, Peralta-Cruz J, Ashfaq M, Rivera G..  (2018)  Synthesis, molecular docking and biological evaluation of novel phthaloyl derivatives of 3-amino-3-aryl propionic acids as inhibitors of Trypanosoma cruzi trans-sialidase.,  156  [PMID:30006170] [10.1016/j.ejmech.2018.07.005]

Source