The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(1,1-Dioxido-2,3-dihydro-1,4-benzothiazepin-4(5H)-yl)-6-methyl-N-(piperidin-2-ylmethyl)quinolin-4-amine ID: ALA4167039
PubChem CID: 145955448
Max Phase: Preclinical
Molecular Formula: C26H31FN4
Molecular Weight: 418.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc2nc(N3CCCc4ccc(F)cc4C3)cc(NCC3CCCCN3)c2c1
Standard InChI: InChI=1S/C26H31FN4/c1-18-7-10-24-23(13-18)25(29-16-22-6-2-3-11-28-22)15-26(30-24)31-12-4-5-19-8-9-21(27)14-20(19)17-31/h7-10,13-15,22,28H,2-6,11-12,16-17H2,1H3,(H,29,30)
Standard InChI Key: QPQVDWJAVLAHGC-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
27.3963 -19.7308 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.1059 -19.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1031 -18.4987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3945 -18.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6882 -19.3219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6905 -18.5041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9846 -18.0950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2759 -18.5026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2776 -19.3235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9841 -19.7289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8143 -19.7289 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3910 -17.2763 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.0969 -16.8647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8064 -17.2702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5123 -16.8586 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.4822 -19.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7513 -20.5442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.3535 -21.0987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1617 -20.9714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2629 -19.5062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.5695 -20.2646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3779 -20.3770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8805 -19.7319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5690 -18.9722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.7615 -18.8634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5681 -18.0941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0686 -18.3255 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
30.2218 -17.2642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8099 -18.0874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5193 -18.4930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2253 -18.0814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5 1 1 0
1 2 2 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 5 2 0
2 11 1 0
4 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
11 16 1 0
16 20 1 0
11 17 1 0
17 18 1 0
21 19 1 0
18 19 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
8 26 1 0
24 27 1 0
15 28 1 0
14 29 1 0
29 30 1 0
28 31 1 0
30 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.56Molecular Weight (Monoisotopic): 418.2533AlogP: 5.19#Rotatable Bonds: 4Polar Surface Area: 40.19Molecular Species: BASEHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.81CX LogP: 5.72CX LogD: 1.98Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.61Np Likeness Score: -1.16
References 1. Zheng X, Liang C, Wang L, Wang B, Liu Y, Feng S, Wu JZ, Gao L, Feng L, Chen L, Guo T, Shen HC, Yun H.. (2018) Discovery of Benzoazepinequinoline (BAQ) Derivatives as Novel, Potent, Orally Bioavailable Respiratory Syncytial Virus Fusion Inhibitors., 61 (22): [PMID:30339388 ] [10.1021/acs.jmedchem.8b01394 ]