The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-amino-N,N-didecyl-5-(diaminomethyleneamino)pentanamide hydrochloride ID: ALA4167253
PubChem CID: 145953612
Max Phase: Preclinical
Molecular Formula: C26H58Cl3N5O
Molecular Weight: 453.76
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCN(CCCCCCCCCC)C(=O)[C@@H](N)CCCN=C(N)N.Cl.Cl.Cl
Standard InChI: InChI=1S/C26H55N5O.3ClH/c1-3-5-7-9-11-13-15-17-22-31(23-18-16-14-12-10-8-6-4-2)25(32)24(27)20-19-21-30-26(28)29;;;/h24H,3-23,27H2,1-2H3,(H4,28,29,30);3*1H/t24-;;;/m0.../s1
Standard InChI Key: LFDSDDCMTRGFAW-VRMKZKMYSA-N
Molfile:
RDKit 2D
35 31 0 0 0 0 0 0 0 0999 V2000
1.4143 -23.7188 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.9272 -22.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6410 -22.1938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3548 -22.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0685 -22.1938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7823 -22.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0685 -21.3703 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2176 -22.1938 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7823 -23.4312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4960 -22.1938 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2098 -22.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4960 -21.3703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2098 -20.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9235 -22.1938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2098 -20.1371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9235 -19.7233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6331 -22.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3468 -22.1938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9235 -18.8998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0607 -22.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6331 -18.4901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7744 -22.1938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6331 -17.6665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4881 -22.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3468 -17.2527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2019 -22.1938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5039 -22.6076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7902 -22.1938 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5039 -23.4312 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0607 -17.6665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2019 -21.3703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7744 -17.2527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9156 -20.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5982 -21.0670 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.9723 -22.2455 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
5 7 1 6
2 8 1 0
6 9 2 0
6 10 1 0
10 11 1 0
10 12 1 0
12 13 1 0
11 14 1 0
13 15 1 0
15 16 1 0
14 17 1 0
17 18 1 0
16 19 1 0
18 20 1 0
19 21 1 0
20 22 1 0
21 23 1 0
22 24 1 0
23 25 1 0
24 26 1 0
8 27 2 0
27 28 1 0
27 29 1 0
25 30 1 0
26 31 1 0
30 32 1 0
31 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 453.76Molecular Weight (Monoisotopic): 453.4407AlogP: 5.48#Rotatable Bonds: 23Polar Surface Area: 110.73Molecular Species: BASEHBA: 3HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 11.31CX LogP: 6.08CX LogD: 2.93Aromatic Rings: ┄Heavy Atoms: 32QED Weighted: 0.11Np Likeness Score: 0.33
References 1. Zhang E, Bai PY, Cui DY, Chu WC, Hua YG, Liu Q, Yin HY, Zhang YJ, Qin S, Liu HM.. (2018) Synthesis and bioactivities study of new antibacterial peptide mimics: The dialkyl cationic amphiphiles., 143 [PMID:29126736 ] [10.1016/j.ejmech.2017.10.044 ]