N2-[2-(1,1-Dioxido-2,3-dihydro-1,4-benzothiazepin-4(5H)-yl)-6-methylquinolin-4-yl]-2-methylpropane-1,2-diamine

ID: ALA4167426

PubChem CID: 145954074

Max Phase: Preclinical

Molecular Formula: C24H29FN4

Molecular Weight: 392.52

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc2nc(N3CCCc4ccc(F)cc4C3)cc(NC(C)(C)CN)c2c1

Standard InChI:  InChI=1S/C24H29FN4/c1-16-6-9-21-20(11-16)22(28-24(2,3)15-26)13-23(27-21)29-10-4-5-17-7-8-19(25)12-18(17)14-29/h6-9,11-13H,4-5,10,14-15,26H2,1-3H3,(H,27,28)

Standard InChI Key:  JHUVGOQFENKBOH-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   16.5584   -1.6509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9712   -2.3608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3796   -1.6484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2734   -5.2277    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9830   -4.8183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9802   -3.9956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2716   -3.5904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5653   -4.8188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5676   -4.0010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8617   -3.5920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1530   -3.9995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1547   -4.8204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8612   -5.2258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6914   -5.2258    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.2681   -2.7732    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.6835   -2.7671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3895   -2.3555    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.3593   -4.7657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6284   -6.0412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2306   -6.5956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0388   -6.4683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1401   -5.0031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4467   -5.7615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2550   -5.8739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7576   -5.2288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4461   -4.4691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6387   -4.3603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4452   -3.5911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9458   -3.8224    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  8  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  9  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  8  2  0
  5 14  1  0
  7 15  1  0
 15  2  1  0
  2 16  1  0
 16 17  1  0
 14 18  1  0
 18 22  1  0
 14 19  1  0
 19 20  1  0
 23 21  1  0
 20 21  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 11 28  1  0
 26 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4167426

    ---

Associated Targets(Human)

HEp-2 (3859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

F Fusion glycoprotein F0 (242 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 392.52Molecular Weight (Monoisotopic): 392.2376AlogP: 4.78#Rotatable Bonds: 4
Polar Surface Area: 54.18Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.83CX LogP: 5.07CX LogD: 1.29
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.67Np Likeness Score: -1.42

References

1. Zheng X, Liang C, Wang L, Wang B, Liu Y, Feng S, Wu JZ, Gao L, Feng L, Chen L, Guo T, Shen HC, Yun H..  (2018)  Discovery of Benzoazepinequinoline (BAQ) Derivatives as Novel, Potent, Orally Bioavailable Respiratory Syncytial Virus Fusion Inhibitors.,  61  (22): [PMID:30339388] [10.1021/acs.jmedchem.8b01394]

Source