N-(4-(2-(dimethylamino)ethoxy)phenyl)-11,12-dihydro-6H-dibenzo[b,f]thiocin-12-amine

ID: ALA4167662

PubChem CID: 145953632

Max Phase: Preclinical

Molecular Formula: C25H28N2OS

Molecular Weight: 404.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)CCOc1ccc(NC2Cc3ccccc3CSc3ccccc32)cc1

Standard InChI:  InChI=1S/C25H28N2OS/c1-27(2)15-16-28-22-13-11-21(12-14-22)26-24-17-19-7-3-4-8-20(19)18-29-25-10-6-5-9-23(24)25/h3-14,24,26H,15-18H2,1-2H3

Standard InChI Key:  YXKKNTACSGAWFM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   10.0548   -0.5607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0549   -2.5307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8744   -2.5307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8744   -0.5606    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.4495   -1.1358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4464   -1.9545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1527   -2.3647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8626   -1.9574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8617   -1.1356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1548   -0.7291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4762   -1.9588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4756   -1.1358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7636   -0.7267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0518   -1.1394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0565   -1.9656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7690   -2.3710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2756   -3.2357    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8625   -3.9409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0478   -3.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6348   -4.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0390   -5.3488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8604   -5.3514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2697   -4.6465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6268   -6.0545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0319   -6.7642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6198   -7.4699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0248   -8.1796    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6127   -8.8853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8420   -8.1837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 12  1  1  0
 11  2  1  0
  2  3  1  0
  3  6  1  0
  5  4  1  0
  4  1  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  3 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4167662

    ---

Associated Targets(non-human)

GCN5 Histone acetyltransferase GCN5 (89 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 404.58Molecular Weight (Monoisotopic): 404.1922AlogP: 5.63#Rotatable Bonds: 6
Polar Surface Area: 24.50Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 8.85CX LogP: 5.38CX LogD: 3.92
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.58Np Likeness Score: -0.81

References

1. Xiong H, Han J, Wang J, Lu W, Wang C, Chen Y, Fulin Lian, Zhang N, Liu YC, Zhang C, Ding H, Jiang H, Lu W, Luo C, Zhou B..  (2018)  Discovery of 1,8-acridinedione derivatives as novel GCN5 inhibitors via high throughput screening.,  151  [PMID:29665527] [10.1016/j.ejmech.2018.02.005]

Source