The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Eupachinsin C ID: ALA4167827
PubChem CID: 145953639
Max Phase: Preclinical
Molecular Formula: C22H28O7
Molecular Weight: 404.46
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=C1C(=O)O[C@@H]2/C=C(/CO)[C@@H](OC(C)=O)C/C=C(\C)C[C@@H](OC(=O)/C(C)=C/C)[C@@H]12
Standard InChI: InChI=1S/C22H28O7/c1-6-13(3)21(25)28-18-9-12(2)7-8-17(27-15(5)24)16(11-23)10-19-20(18)14(4)22(26)29-19/h6-7,10,17-20,23H,4,8-9,11H2,1-3,5H3/b12-7+,13-6+,16-10-/t17-,18+,19+,20+/m0/s1
Standard InChI Key: MUZYRVFSXXFTOF-IMYVKFHPSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
16.3748 -16.0373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3748 -16.8623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0868 -15.6206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7988 -16.0373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7953 -16.8623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2244 -16.0433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5110 -15.6255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0142 -17.5039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9372 -17.7206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6888 -18.2239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5544 -17.1772 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8256 -16.7907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1264 -17.2285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7960 -15.9662 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.2209 -16.8683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6832 -17.5037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1213 -18.2115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9299 -18.0134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9912 -17.1834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5596 -18.5464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.6927 -16.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9410 -15.6346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.9453 -14.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6619 -14.4009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2330 -14.3933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.3742 -14.8171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6662 -13.5759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8679 -18.3055 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.0908 -14.4084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4331 -17.6622 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
18.4664 -18.2956 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 1 0
4 3 2 0
4 5 1 0
4 7 1 0
15 6 1 0
6 7 1 0
2 8 1 0
8 9 2 0
9 16 1 0
8 10 1 0
2 11 1 1
11 12 1 0
12 13 1 0
12 14 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
15 19 1 0
18 20 2 0
19 21 2 0
6 22 1 1
22 23 1 0
23 24 1 0
23 25 2 0
24 26 2 0
24 27 1 0
10 28 1 0
26 29 1 0
15 30 1 6
16 31 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 404.46Molecular Weight (Monoisotopic): 404.1835AlogP: 2.55#Rotatable Bonds: 4Polar Surface Area: 99.13Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.61CX LogD: 2.61Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.33Np Likeness Score: 3.24
References 1. Yu X, Zhang Q, Tian L, Guo Z, Liu C, Chen J, Ebrahim W, Liu Z, Proksch P, Zou K.. (2018) Germacrane-Type Sesquiterpenoids with Antiproliferative Activities from Eupatorium chinense., 81 (1): [PMID:29280632 ] [10.1021/acs.jnatprod.7b00693 ]