The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(5-Chloro-2-(2,4-dichlorophenoxy)phenoxy)butyl(E)-3-(3,4-bis((tert-butyldimethylsilyl)oxy)phenyl)prop-2-enoate ID: ALA4168168
PubChem CID: 145952765
Max Phase: Preclinical
Molecular Formula: C34H31Cl3O6
Molecular Weight: 641.97
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C/C(=O)c2ccc(OCCCCCOc3cc(Cl)ccc3Oc3ccc(Cl)cc3Cl)cc2)cc1OC
Standard InChI: InChI=1S/C34H31Cl3O6/c1-39-31-15-7-23(20-33(31)40-2)6-14-29(38)24-8-12-27(13-9-24)41-18-4-3-5-19-42-34-22-26(36)11-17-32(34)43-30-16-10-25(35)21-28(30)37/h6-17,20-22H,3-5,18-19H2,1-2H3/b14-6+
Standard InChI Key: KAJCVUOGJLPZNO-MKMNVTDBSA-N
Molfile:
RDKit 2D
43 46 0 0 0 0 0 0 0 0999 V2000
26.2251 -18.8974 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.9358 -18.4785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6495 -18.8879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3597 -18.4697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3527 -17.6438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6296 -17.2380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9223 -17.6586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0630 -17.2240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7817 -17.6292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0545 -16.3990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.4919 -17.2093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2105 -17.6144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2142 -18.4387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9320 -18.8438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6433 -18.4239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6321 -17.5946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9137 -17.1933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3625 -18.8280 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.3721 -19.6530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.3408 -17.1723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.0609 -17.5750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3820 -20.1876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3809 -21.0149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0957 -21.4279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8122 -21.0144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8092 -20.1840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0938 -19.7748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0914 -18.9498 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
17.6660 -21.4269 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20.5222 -19.7687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2383 -20.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2380 -21.0012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9531 -21.4110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6671 -20.9957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6612 -20.1664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9456 -19.7605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3836 -21.4045 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
21.9381 -18.9354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6489 -18.5166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3670 -18.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0778 -18.5038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7960 -18.9099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5067 -18.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
5 8 1 0
8 9 1 0
8 10 2 0
9 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
15 18 1 0
18 19 1 0
16 20 1 0
20 21 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
27 28 1 0
23 29 1 0
26 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 31 1 0
34 37 1 0
36 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
42 43 1 0
43 1 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 641.97Molecular Weight (Monoisotopic): 640.1186AlogP: 9.98#Rotatable Bonds: 15Polar Surface Area: 63.22Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 9.40CX LogD: 9.40Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.07Np Likeness Score: -0.43
References 1. Otero E, García E, Palacios G, Yepes LM, Carda M, Agut R, Vélez ID, Cardona WI, Robledo SM.. (2017) Triclosan-caffeic acid hybrids: Synthesis, leishmanicidal, trypanocidal and cytotoxic activities., 141 [PMID:29028533 ] [10.1016/j.ejmech.2017.09.064 ] 2. de Mello MVP, Abrahim-Vieira BA, Domingos TFS, de Jesus JB, de Sousa ACC, Rodrigues CR, Souza AMT.. (2018) A comprehensive review of chalcone derivatives as antileishmanial agents., 150 [PMID:29602038 ] [10.1016/j.ejmech.2018.03.047 ]