The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Banksialactone H ID: ALA4168443
PubChem CID: 145953218
Max Phase: Preclinical
Molecular Formula: C23H26O9
Molecular Weight: 446.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(O)c2c(c1C)[C@H](C)[C@](O)(COC(=O)c1c(C)c(C)c(O)c(C)c1O)OC2=O
Standard InChI: InChI=1S/C23H26O9/c1-9-10(2)19(25)12(4)20(26)17(9)21(27)31-8-23(29)13(5)16-11(3)15(30-6)7-14(24)18(16)22(28)32-23/h7,13,24-26,29H,8H2,1-6H3/t13-,23-/m0/s1
Standard InChI Key: LAONCLCOCCMFGL-NPMABZOXSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
14.8151 -10.6456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8140 -11.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5287 -11.8859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5269 -10.2329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5285 -12.7109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5245 -9.4079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0991 -11.8850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3849 -11.4719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2423 -10.6420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2412 -11.4705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9541 -11.8835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6728 -11.4726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6739 -10.6440 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9564 -10.2265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9564 -9.4016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3860 -11.8870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1017 -11.4765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9518 -12.7085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6664 -12.2958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8149 -11.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5306 -11.4805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8126 -12.7160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2413 -11.8986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9565 -11.4888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9592 -10.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2408 -10.2486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5287 -10.6608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8135 -10.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2402 -9.4236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2367 -12.7236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6743 -10.2515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.6695 -11.9036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 10 2 0
9 4 2 0
4 1 1 0
3 5 1 0
4 6 1 0
2 7 1 0
7 8 1 0
9 10 1 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
12 16 1 1
16 17 1 0
11 18 1 1
12 19 1 0
17 20 1 0
20 21 1 0
20 22 2 0
21 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 21 1 0
27 28 1 0
26 29 1 0
23 30 1 0
25 31 1 0
24 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.45Molecular Weight (Monoisotopic): 446.1577AlogP: 2.87#Rotatable Bonds: 4Polar Surface Area: 142.75Molecular Species: NEUTRALHBA: 9HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.28CX Basic pKa: ┄CX LogP: 6.03CX LogD: 6.02Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.52Np Likeness Score: 1.40
References 1. Chaudhary NK, Pitt JI, Lacey E, Crombie A, Vuong D, Piggott AM, Karuso P.. (2018) Banksialactones and Banksiamarins: Isochromanones and Isocoumarins from an Australian Fungus, Aspergillus banksianus., 81 (7): [PMID:29920099 ] [10.1021/acs.jnatprod.7b00816 ]