The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-(16-Hydroxyhexadec-9-enoyl)-L-alanine Methyl Ester ID: ALA4168698
PubChem CID: 139589881
Max Phase: Preclinical
Molecular Formula: C20H37NO4
Molecular Weight: 355.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@H](C)NC(=O)CCCCCCC/C=C\CCCCCCO
Standard InChI: InChI=1S/C20H37NO4/c1-18(20(24)25-2)21-19(23)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-22/h3,5,18,22H,4,6-17H2,1-2H3,(H,21,23)/b5-3-/t18-/m0/s1
Standard InChI Key: XWFACHYZFVZDPE-AJNOYIKESA-N
Molfile:
RDKit 2D
25 24 0 0 0 0 0 0 0 0999 V2000
4.6606 -4.6864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6798 -3.8695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3969 -3.4776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0948 -3.9027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8119 -3.5108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5098 -3.9358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2269 -3.5439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9249 -3.9690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6420 -3.5771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3399 -4.0022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0570 -3.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7549 -4.0353 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0761 -2.7933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4720 -3.6435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1700 -4.0685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4912 -2.8265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1508 -4.8855 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8870 -3.6766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5850 -4.1017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9435 -5.0783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9244 -5.8953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2073 -6.2872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1881 -7.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4711 -7.4961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4519 -8.3130 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
12 14 1 0
14 15 1 0
14 16 1 1
15 17 2 0
15 18 1 0
18 19 1 0
1 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 355.52Molecular Weight (Monoisotopic): 355.2723AlogP: 3.89#Rotatable Bonds: 16Polar Surface Area: 75.63Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.85CX Basic pKa: ┄CX LogP: 4.07CX LogD: 4.07Aromatic Rings: ┄Heavy Atoms: 25QED Weighted: 0.25Np Likeness Score: 0.46
References 1. Bruns H, Herrmann J, Müller R, Wang H, Wagner Döbler I, Schulz S.. (2018) Oxygenated N-Acyl Alanine Methyl Esters (NAMEs) from the Marine Bacterium Roseovarius tolerans EL-164., 81 (1): [PMID:29261310 ] [10.1021/acs.jnatprod.7b00757 ]