2-(6-chloro-5-((2R,5R)-4-(4-fluorobenzyl)-2,5-dimethylpiperazine-1-carbonyl)-1-methyl-1H-indol-3-yl)-N,N-dimethyl-2-oxoacetamide

ID: ALA4168810

PubChem CID: 124518203

Max Phase: Preclinical

Molecular Formula: C27H30ClFN4O3

Molecular Weight: 513.01

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@@H]1CN(C(=O)c2cc3c(C(=O)C(=O)N(C)C)cn(C)c3cc2Cl)[C@H](C)CN1Cc1ccc(F)cc1

Standard InChI:  InChI=1S/C27H30ClFN4O3/c1-16-13-33(17(2)12-32(16)14-18-6-8-19(29)9-7-18)26(35)21-10-20-22(25(34)27(36)30(3)4)15-31(5)24(20)11-23(21)28/h6-11,15-17H,12-14H2,1-5H3/t16-,17-/m1/s1

Standard InChI Key:  ZMELOYOKMZBMRB-IAGOWNOFSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   13.5441  -13.8592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5430  -14.6787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2510  -15.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2493  -13.4503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9579  -13.8556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9627  -14.6742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7427  -14.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2201  -14.2575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7350  -13.5981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8363  -13.4508    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   15.9829  -12.8195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9997  -15.6984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4565  -16.3088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8001  -15.8636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0571  -16.6393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.3433  -15.2532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.5138  -17.2498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8574  -16.8046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8350  -15.0868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1276  -14.6776    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8343  -15.9040    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1246  -16.3072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1220  -17.1208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8276  -17.5338    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5374  -17.1270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5417  -16.3072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8239  -18.3510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5297  -18.7628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5226  -19.5806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2276  -19.9924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9381  -19.5870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9392  -18.7655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2336  -18.3575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6445  -19.9978    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.4190  -15.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2434  -17.5385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  1 10  1  0
  9 11  1  0
  7 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 15 18  1  0
  2 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 24 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 31 34  1  0
 22 35  1  1
 25 36  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4168810

    ---

Associated Targets(Human)

MAPK13 Tchem MAP kinase p38 (1586 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 513.01Molecular Weight (Monoisotopic): 512.1990AlogP: 3.98#Rotatable Bonds: 5
Polar Surface Area: 65.86Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.87CX LogP: 3.90CX LogD: 3.89
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.38Np Likeness Score: -1.30

References

1. Bistrović A, Krstulović L, Harej A, Grbčić P, Sedić M, Koštrun S, Pavelić SK, Bajić M, Raić-Malić S..  (2018)  Design, synthesis and biological evaluation of novel benzimidazole amidines as potent multi-target inhibitors for the treatment of non-small cell lung cancer.,  143  [PMID:29133046] [10.1016/j.ejmech.2017.10.061]

Source