The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(6-chloro-5-((2R,5R)-4-(4-fluorobenzyl)-2,5-dimethylpiperazine-1-carbonyl)-1-methyl-1H-indol-3-yl)-N,N-dimethyl-2-oxoacetamide ID: ALA4168810
PubChem CID: 124518203
Max Phase: Preclinical
Molecular Formula: C27H30ClFN4O3
Molecular Weight: 513.01
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H]1CN(C(=O)c2cc3c(C(=O)C(=O)N(C)C)cn(C)c3cc2Cl)[C@H](C)CN1Cc1ccc(F)cc1
Standard InChI: InChI=1S/C27H30ClFN4O3/c1-16-13-33(17(2)12-32(16)14-18-6-8-19(29)9-7-18)26(35)21-10-20-22(25(34)27(36)30(3)4)15-31(5)24(20)11-23(21)28/h6-11,15-17H,12-14H2,1-5H3/t16-,17-/m1/s1
Standard InChI Key: ZMELOYOKMZBMRB-IAGOWNOFSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
13.5441 -13.8592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5430 -14.6787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2510 -15.0877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2493 -13.4503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9579 -13.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9627 -14.6742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7427 -14.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2201 -14.2575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7350 -13.5981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.8363 -13.4508 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.9829 -12.8195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9997 -15.6984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4565 -16.3088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8001 -15.8636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0571 -16.6393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3433 -15.2532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.5138 -17.2498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8574 -16.8046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8350 -15.0868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1276 -14.6776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8343 -15.9040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1246 -16.3072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1220 -17.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8276 -17.5338 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5374 -17.1270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5417 -16.3072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8239 -18.3510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5297 -18.7628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5226 -19.5806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2276 -19.9924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9381 -19.5870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9392 -18.7655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2336 -18.3575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6445 -19.9978 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.4190 -15.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2434 -17.5385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
1 10 1 0
9 11 1 0
7 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
15 18 1 0
2 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
22 35 1 1
25 36 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 513.01Molecular Weight (Monoisotopic): 512.1990AlogP: 3.98#Rotatable Bonds: 5Polar Surface Area: 65.86Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.87CX LogP: 3.90CX LogD: 3.89Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.38Np Likeness Score: -1.30
References 1. Bistrović A, Krstulović L, Harej A, Grbčić P, Sedić M, Koštrun S, Pavelić SK, Bajić M, Raić-Malić S.. (2018) Design, synthesis and biological evaluation of novel benzimidazole amidines as potent multi-target inhibitors for the treatment of non-small cell lung cancer., 143 [PMID:29133046 ] [10.1016/j.ejmech.2017.10.061 ]