2-(3-chlorobenzo[b]thiophen-2-yl)-3-(4-fluorophenyl)quinazolin-4(3H)-one

ID: ALA4168856

PubChem CID: 145952792

Max Phase: Preclinical

Molecular Formula: C22H12ClFN2OS

Molecular Weight: 406.87

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=c1c2ccccc2nc(-c2sc3ccccc3c2Cl)n1-c1ccc(F)cc1

Standard InChI:  InChI=1S/C22H12ClFN2OS/c23-19-16-6-2-4-8-18(16)28-20(19)21-25-17-7-3-1-5-15(17)22(27)26(21)14-11-9-13(24)10-12-14/h1-12H

Standard InChI Key:  JWMJMYMNUCSSCW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
   15.0217   -2.6785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0205   -3.4981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7286   -3.9070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7268   -2.2697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4354   -2.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4388   -3.5001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1512   -3.9075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.8648   -3.4943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8614   -2.6691    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1444   -2.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5736   -3.9009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1399   -1.4400    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6618   -4.7121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3198   -3.5653    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.8683   -4.1710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4631   -4.8769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8718   -5.5787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6855   -5.5758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0888   -4.8652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6779   -4.1664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0574   -5.2621    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   18.5668   -2.2586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2760   -2.6668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9820   -2.2567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9799   -1.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2659   -1.0324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5629   -1.4448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6858   -1.0269    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
  8 11  1  0
 10 12  2  0
 11 13  2  0
 13 16  1  0
 15 14  1  0
 14 11  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 13 21  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
  9 22  1  0
 25 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4168856

    ---

Associated Targets(non-human)

Candida (1648 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Aspergillus niger (16508 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 406.87Molecular Weight (Monoisotopic): 406.0343AlogP: 6.06#Rotatable Bonds: 2
Polar Surface Area: 34.89Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.26CX LogD: 6.26
Aromatic Rings: 5Heavy Atoms: 28QED Weighted: 0.36Np Likeness Score: -1.50

References

1. Keri RS, Chand K, Budagumpi S, Balappa Somappa S, Patil SA, Nagaraja BM..  (2017)  An overview of benzo[b]thiophene-based medicinal chemistry.,  138  [PMID:28759875] [10.1016/j.ejmech.2017.07.038]

Source