(E)-(2-(Hydroxymethyl)-4-((1-methyl-5-nitro-1H-indol-3-yl)-methylene)-5-oxotetrahydrofuran-2-yl)methyl Pivalate

ID: ALA4168982

PubChem CID: 145954400

Max Phase: Preclinical

Molecular Formula: C21H24N2O7

Molecular Weight: 416.43

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1cc(/C=C2\CC(CO)(COC(=O)C(C)(C)C)OC2=O)c2cc([N+](=O)[O-])ccc21

Standard InChI:  InChI=1S/C21H24N2O7/c1-20(2,3)19(26)29-12-21(11-24)9-13(18(25)30-21)7-14-10-22(4)17-6-5-15(23(27)28)8-16(14)17/h5-8,10,24H,9,11-12H2,1-4H3/b13-7+

Standard InChI Key:  LWIQJWIQVPZBME-NTUHNPAUSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   39.4646  -17.9163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1786  -17.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4692  -17.0952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4323  -18.2938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2536  -18.2938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5080  -17.5130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8450  -17.0267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.2897  -17.2615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.6581  -19.0036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2401  -19.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1947  -21.0392    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.7029  -20.3918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4224  -20.7604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4559  -19.9450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7669  -19.5080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0440  -19.8895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0143  -20.7082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7040  -21.1374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.4197  -21.8289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4599  -18.7376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.7551  -17.5038    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.0456  -17.0871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3314  -17.4958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0502  -16.2658    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.6253  -17.0845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3283  -18.3129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6209  -17.8998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3486  -19.4526    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.6262  -19.8347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.3789  -18.6360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  2  1  0
  2  4  1  0
  6  8  2  0
  5  9  2  0
  9 10  1  0
 13 11  1  0
 11 12  1  0
 12 10  2  0
 10 14  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 13  1  0
 11 19  1  0
  1 20  1  0
  3 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  1  0
 23 26  1  0
 23 27  1  0
 28 29  2  0
 28 30  1  0
 16 28  1  0
M  CHG  2  28   1  30  -1
M  END

Alternative Forms

  1. Parent:

    ALA4168982

    ---

Associated Targets(Human)

PRKCE Tchem Protein kinase C epsilon (1520 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PRKCA Tchem Protein kinase C alpha (5923 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RASGRP3 Tchem RAS guanyl releasing protein 3 (130 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 416.43Molecular Weight (Monoisotopic): 416.1584AlogP: 2.74#Rotatable Bonds: 5
Polar Surface Area: 120.90Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.54CX LogD: 3.54
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.34Np Likeness Score: -0.09

References

1. Ann J, Czikora A, Saini AS, Zhou X, Mitchell GA, Lewin NE, Peach ML, Blumberg PM, Lee J..  (2018)  α-Arylidene Diacylglycerol-Lactones (DAG-Lactones) as Selective Ras Guanine-Releasing Protein 3 (RasGRP3) Ligands.,  61  (14): [PMID:29860841] [10.1021/acs.jmedchem.8b00661]

Source