The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Prop-2-yn-1-yl-6-(2-(N-Acetylacetamido)pyridin-4-yl)-2-amino-4-(2-oxo-2-(prop-2-yn-1-yloxy)ethyl)-4H-chromene-3-carboxylate ID: ALA4168985
PubChem CID: 145954627
Max Phase: Preclinical
Molecular Formula: C27H23N3O7
Molecular Weight: 501.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#CCOC(=O)CC1C(C(=O)OCC#C)=C(N)Oc2ccc(-c3ccnc(N(C(C)=O)C(C)=O)c3)cc21
Standard InChI: InChI=1S/C27H23N3O7/c1-5-11-35-24(33)15-21-20-13-18(19-9-10-29-23(14-19)30(16(3)31)17(4)32)7-8-22(20)37-26(28)25(21)27(34)36-12-6-2/h1-2,7-10,13-14,21H,11-12,15,28H2,3-4H3
Standard InChI Key: CWBRALMXCMJUPW-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 39 0 0 0 0 0 0 0 0999 V2000
39.3357 -27.3539 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.3346 -28.1813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0494 -28.5941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7658 -28.1808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7630 -27.3503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0476 -26.9412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4810 -28.5922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4774 -29.4175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1916 -29.8288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1876 -28.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9024 -28.5858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9035 -29.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6156 -29.8218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.3310 -29.4101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3300 -28.5840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6134 -28.1696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0455 -29.8226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.0443 -28.1712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7589 -28.5835 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.0441 -27.3462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
46.4733 -28.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.4730 -27.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.4727 -26.5208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6111 -27.3446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8956 -26.9340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8933 -26.1090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.1822 -27.3485 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.6067 -25.6946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3223 -26.1052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0378 -26.5158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6198 -28.5932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.9057 -28.1801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1909 -28.5921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9063 -27.3551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.6191 -29.4182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9044 -29.8301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.3333 -29.8312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
7 8 2 0
8 9 1 0
9 12 2 0
11 10 2 0
10 7 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
14 17 1 0
15 18 1 0
18 19 1 0
18 20 2 0
19 21 1 0
21 22 1 0
22 23 3 0
16 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
29 30 3 0
2 31 1 0
31 32 1 0
32 33 1 0
32 34 2 0
31 35 1 0
35 36 2 0
35 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.50Molecular Weight (Monoisotopic): 501.1536AlogP: 2.04#Rotatable Bonds: 7Polar Surface Area: 138.12Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 2.64CX LogP: 1.67CX LogD: 1.67Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.45Np Likeness Score: -0.38
References 1. Bian T, Chandagirikoppal Vijendra K, Wang Y, Meacham A, Hati S, Cogle CR, Sun H, Xing C.. (2018) Exploring the Structure-Activity Relationship and Mechanism of a Chromene Scaffold (CXL Series) for Its Selective Antiproliferative Activity toward Multidrug-Resistant Cancer Cells., 61 (15): [PMID:29995404 ] [10.1021/acs.jmedchem.8b00813 ]