(S)-N-(3-(acetimidamidomethyl)benzyl)-2-amino-4-methylpentanamide dihydrochloride

ID: ALA4169004

PubChem CID: 145955529

Max Phase: Preclinical

Molecular Formula: C16H28Cl2N4O

Molecular Weight: 290.41

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(=N)NCc1cccc(CNC(=O)[C@@H](N)CC(C)C)c1.Cl.Cl

Standard InChI:  InChI=1S/C16H26N4O.2ClH/c1-11(2)7-15(18)16(21)20-10-14-6-4-5-13(8-14)9-19-12(3)17;;/h4-6,8,11,15H,7,9-10,18H2,1-3H3,(H2,17,19)(H,20,21);2*1H/t15-;;/m0../s1

Standard InChI Key:  RAENNAICWFYKQO-CKUXDGONSA-N

Molfile:  

     RDKit          2D

 23 21  0  0  0  0  0  0  0  0999 V2000
   31.9098   -2.8580    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   25.4315   -3.1124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4303   -3.9397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1451   -4.3526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8615   -3.9393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8587   -3.1088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1433   -2.6996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7169   -2.7001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0026   -3.1127    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.5716   -2.6935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2876   -3.1034    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.0005   -2.6882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.7165   -3.0980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9974   -1.8632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.4294   -2.6828    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.2880   -2.7004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5737   -3.1131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2878   -1.8754    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.7196   -3.9230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4357   -4.3327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.4387   -5.1577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1485   -3.9176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2786   -1.8562    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  2  8  1  0
  8  9  1  0
  6 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  1  0
  9 16  1  0
 16 17  1  0
 16 18  2  0
 13 19  1  1
 19 20  1  0
 20 21  1  0
 20 22  1  0
M  END

Associated Targets(non-human)

NOS3 Nitric-oxide synthase, endothelial (692 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Nos2 Nitric oxide synthase, inducible (3573 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 290.41Molecular Weight (Monoisotopic): 290.2107AlogP: 1.76#Rotatable Bonds: 7
Polar Surface Area: 91.00Molecular Species: BASEHBA: 3HBD: 4
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 12.16CX LogP: 0.88CX LogD: -2.59
Aromatic Rings: 1Heavy Atoms: 21QED Weighted: 0.46Np Likeness Score: 0.07

References

1. Maccallini C, Di Matteo M, Gallorini M, Montagnani M, Graziani V, Ammazzalorso A, Amoia P, De Filippis B, Di Silvestre S, Fantacuzzi M, Giampietro L, Potenza MA, Re N, Pandolfi A, Cataldi A, Amoroso R..  (2018)  Discovery of N-{3-[(ethanimidoylamino)methyl]benzyl}-l-prolinamide dihydrochloride: A new potent and selective inhibitor of the inducible nitric oxide synthase as a promising agent for the therapy of malignant glioma.,  152  [PMID:29689474] [10.1016/j.ejmech.2018.04.027]

Source