The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-Trifluoromethyl-2'-(3-trifluoromethyl-phenoxymethyl)-biphenyl-3-sulfonic acid [2-(3-fluoro-phenyl)-ethyl]-amide ID: ALA4169245
PubChem CID: 145955071
Max Phase: Preclinical
Molecular Formula: C29H22F7NO3S
Molecular Weight: 597.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(NCCc1cccc(F)c1)c1cc(-c2ccccc2COc2cccc(C(F)(F)F)c2)cc(C(F)(F)F)c1
Standard InChI: InChI=1S/C29H22F7NO3S/c30-24-8-3-5-19(13-24)11-12-37-41(38,39)26-15-21(14-23(17-26)29(34,35)36)27-10-2-1-6-20(27)18-40-25-9-4-7-22(16-25)28(31,32)33/h1-10,13-17,37H,11-12,18H2
Standard InChI Key: CWQLLFSYJQEAJG-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
20.9749 -23.9165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7999 -23.9206 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.3909 -23.2040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0942 -25.1623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0931 -25.9896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8078 -26.4025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5243 -25.9892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5215 -25.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8061 -24.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3783 -26.4016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6642 -25.9885 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.3776 -27.2266 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.6582 -26.8081 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.5168 -23.5098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.2325 -23.9202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9458 -23.5056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6614 -23.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6619 -24.7383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3768 -25.1486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0910 -24.7340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0859 -23.9048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3705 -23.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3789 -25.9736 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
23.2358 -26.3998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2358 -27.2259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9501 -27.6372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6649 -27.2234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6609 -26.3942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9461 -25.9867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5216 -27.6388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5220 -28.4638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8078 -28.8766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0950 -28.4628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3812 -28.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3812 -29.7009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1009 -30.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8118 -29.6983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1043 -30.9378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3915 -31.3532 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.8205 -31.3473 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.0998 -31.8622 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
5 10 1 0
10 11 1 0
10 12 1 0
10 13 1 0
9 2 1 0
2 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
19 23 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
7 24 1 0
25 30 1 0
30 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
36 38 1 0
38 39 1 0
38 40 1 0
38 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 597.55Molecular Weight (Monoisotopic): 597.1209AlogP: 7.63#Rotatable Bonds: 9Polar Surface Area: 55.40Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.90CX Basic pKa: ┄CX LogP: 7.93CX LogD: 7.93Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.20Np Likeness Score: -1.33
References 1. Giordano A, Forte G, Massimo L, Riccio R, Bifulco G, Di Micco S.. (2018) Discovery of new erbB4 inhibitors: Repositioning an orphan chemical library by inverse virtual screening., 152 [PMID:29730188 ] [10.1016/j.ejmech.2018.04.018 ]