The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3-(4-(benzyloxy)phenyl)-5-(o-tolyl)-4,5-dihydro-1H-pyrazol-1-yl)benzenesulfonamide ID: ALA4169590
PubChem CID: 145954652
Max Phase: Preclinical
Molecular Formula: C29H27N3O3S
Molecular Weight: 497.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccccc1C1CC(c2ccc(OCc3ccccc3)cc2)=NN1c1ccc(S(N)(=O)=O)cc1
Standard InChI: InChI=1S/C29H27N3O3S/c1-21-7-5-6-10-27(21)29-19-28(31-32(29)24-13-17-26(18-14-24)36(30,33)34)23-11-15-25(16-12-23)35-20-22-8-3-2-4-9-22/h2-18,29H,19-20H2,1H3,(H2,30,33,34)
Standard InChI Key: KQJSMGRIECJFJA-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
24.9532 -16.9464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.1319 -16.9464 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
24.5446 -17.6582 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.1360 -13.6652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.8031 -13.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5488 -12.4024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7274 -12.4024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4689 -13.1873 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5104 -13.5951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1360 -14.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5061 -14.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2125 -14.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9224 -14.4157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9213 -13.5945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2143 -13.1905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4219 -14.8974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4215 -15.7180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1339 -16.1274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8481 -15.7144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8449 -14.8952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0134 -11.9896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0151 -11.1653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3020 -10.7568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5880 -11.1673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5917 -11.9947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3055 -12.4037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4237 -17.3624 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8751 -10.7605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.1644 -11.1710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1665 -11.9923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4553 -12.4029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4571 -13.2235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1706 -13.6311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8837 -13.2162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8784 -12.3970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2132 -12.3692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
7 8 2 0
5 6 1 0
4 5 1 0
6 7 1 0
8 4 1 0
5 9 1 0
4 10 1 0
9 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 9 1 0
10 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 10 1 0
7 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
18 2 1 0
2 27 1 0
24 28 1 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
15 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.62Molecular Weight (Monoisotopic): 497.1773AlogP: 5.58#Rotatable Bonds: 7Polar Surface Area: 84.99Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.64CX Basic pKa: 4.20CX LogP: 6.10CX LogD: 6.10Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.36Np Likeness Score: -1.30
References 1. Fioravanti R, Desideri N, Carta A, Atzori EM, Delogu I, Collu G, Loddo R.. (2017) Inhibitors of Yellow Fever Virus replication based on 1,3,5-triphenyl-4,5-dihydropyrazole scaffold: Design, synthesis and antiviral evaluation., 141 [PMID:29028528 ] [10.1016/j.ejmech.2017.09.060 ]